About 4-[2-[[4-[difluoro(phosphono)methyl]phenyl]methyl]-3-oxo-2,3-diphenylpropyl]benzoic acid
4-[2-[[4-[difluoro(phosphono)methyl]phenyl]methyl]-3-oxo-2,3-diphenylpropyl]benzoic acid (PubChem CID 21265708) has the molecular formula C30H25F2O6P
and a molecular weight of 550.49 g/mol. Its IUPAC name is 4-[2-[[4-[difluoro(phosphono)methyl]phenyl]methyl]-3-oxo-2,3-diphenylpropyl]benzoic acid.
Molecular Properties
| Compound Name | 4-[2-[[4-[difluoro(phosphono)methyl]phenyl]methyl]-3-oxo-2,3-diphenylpropyl]benzoic acid |
| PubChem CID | 21265708 |
| Molecular Formula | C30H25F2O6P |
| Molecular Weight | 550.49 g/mol |
| Exact Mass | 550.14 |
| IUPAC Name | 4-[2-[[4-[difluoro(phosphono)methyl]phenyl]methyl]-3-oxo-2,3-diphenylpropyl]benzoic acid |
| SMILES | O=C(O)c1ccc(CC(Cc2ccc(C(F)(F)P(=O)(O)O)cc2)(C(=O)c2ccccc2)c2ccccc2)cc1 |
| InChI | InChI=1S/C30H25F2O6P/c31-30(32,39(36,37)38)26-17-13-22(14-18-26)20-29(25-9-5-2-6-10-25,27(33)23-7-3-1-4-8-23)19-21-11-15-24(16-12-21)28(34)35/h1-18H,19-20H2,(H,34,35)(H2,36,37,38) |
| InChIKey | NAUCBJQHAWOWPM-UHFFFAOYSA-N |
| XLogP | 6.22 |
| TPSA | 111.90 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 39 |
| Complexity | — |
Lipinski Rule of Five
2 violations
| Rule | Value |
| MW ≤ 500 | 550.49 |
| LogP ≤ 5 | 6.22 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 3 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'phosphor', 'substructure': 'N/A'} |
|---|
Analyze 4-[2-[[4-[difluoro(phosphono)methyl]phenyl]methyl]-3-oxo-2,3-diphenylpropyl]benzoic acid with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 4-[2-[[4-[difluoro(phosphono)methyl]phenyl]methyl]-3-oxo-2,3-diphenylpropyl]benzoic acid?
The IUPAC name of 4-[2-[[4-[difluoro(phosphono)methyl]phenyl]methyl]-3-oxo-2,3-diphenylpropyl]benzoic acid (CID 21265708) is 4-[2-[[4-[difluoro(phosphono)methyl]phenyl]methyl]-3-oxo-2,3-diphenylpropyl]benzoic acid.
What is the SMILES notation for 4-[2-[[4-[difluoro(phosphono)methyl]phenyl]methyl]-3-oxo-2,3-diphenylpropyl]benzoic acid?
The canonical SMILES for 4-[2-[[4-[difluoro(phosphono)methyl]phenyl]methyl]-3-oxo-2,3-diphenylpropyl]benzoic acid is O=C(O)c1ccc(CC(Cc2ccc(C(F)(F)P(=O)(O)O)cc2)(C(=O)c2ccccc2)c2ccccc2)cc1.
What is the InChIKey of 4-[2-[[4-[difluoro(phosphono)methyl]phenyl]methyl]-3-oxo-2,3-diphenylpropyl]benzoic acid?
The InChIKey is NAUCBJQHAWOWPM-UHFFFAOYSA-N. The full InChI is InChI=1S/C30H25F2O6P/c31-30(32,39(36,37)38)26-17-13-22(14-18-26)20-29(25-9-5-2-6-10-25,27(33)23-7-3-1-4-8-23)19-21-11-15-24(16-12-21)28(34)35/h1-18H,19-20H2,(H,34,35)(H2,36,37,38).
What are the key properties of 4-[2-[[4-[difluoro(phosphono)methyl]phenyl]methyl]-3-oxo-2,3-diphenylpropyl]benzoic acid?
4-[2-[[4-[difluoro(phosphono)methyl]phenyl]methyl]-3-oxo-2,3-diphenylpropyl]benzoic acid has a molecular weight of 550.49 g/mol, XLogP of 6.22, 10 rotatable bonds, 3 hydrogen bond donors, and 3 hydrogen bond acceptors.
Where does this data come from?
All data for 4-[2-[[4-[difluoro(phosphono)methyl]phenyl]methyl]-3-oxo-2,3-diphenylpropyl]benzoic acid is sourced from PubChem (CID 21265708), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).