C30H26F4O7P2 — CID 21265715
[[4-[2-[[4-[difluoro(phosphono)methyl]phenyl]methyl]-3-oxo-2,3-diphenylpropyl]phenyl]-difluoromethyl]phosphonic acid (PubChem CID 21265715) has the molecular formula C30H26F4O7P2 and a molecular weight of 636.47 g/mol. Its IUPAC name is [[4-[2-[[4-[difluoro(phosphono)methyl]phenyl]methyl]-3-oxo-2,3-diphenylpropyl]phenyl]-difluoromethyl]phosphonic acid.
| Compound Name | [[4-[2-[[4-[difluoro(phosphono)methyl]phenyl]methyl]-3-oxo-2,3-diphenylpropyl]phenyl]-difluoromethyl]phosphonic acid |
|---|---|
| PubChem CID | 21265715 |
| Molecular Formula | C30H26F4O7P2 |
| Molecular Weight | 636.47 g/mol |
| Exact Mass | 636.11 |
| IUPAC Name | [[4-[2-[[4-[difluoro(phosphono)methyl]phenyl]methyl]-3-oxo-2,3-diphenylpropyl]phenyl]-difluoromethyl]phosphonic acid |
| SMILES | O=C(c1ccccc1)C(Cc1ccc(C(F)(F)P(=O)(O)O)cc1)(Cc1ccc(C(F)(F)P(=O)(O)O)cc1)c1ccccc1 |
| InChI | InChI=1S/C30H26F4O7P2/c31-29(32,42(36,37)38)25-15-11-21(12-16-25)19-28(24-9-5-2-6-10-24,27(35)23-7-3-1-4-8-23)20-22-13-17-26(18-14-22)30(33,34)43(39,40)41/h1-18H,19-20H2,(H2,36,37,38)(H2,39,40,41) |
| InChIKey | IZDWSIZSMHRZPZ-UHFFFAOYSA-N |
| XLogP | 6.75 |
| TPSA | 132.13 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 11 |
| Heavy Atoms | 43 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 636.47 |
| LogP ≤ 5 | 6.75 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'phosphor', 'substructure': 'N/A'} |
|---|