About S-(2-imidazo[1,2-a]pyrazin-2-ylethyl) ethanethioate
S-(2-imidazo[1,2-a]pyrazin-2-ylethyl) ethanethioate (PubChem CID 21265894) has the molecular formula C10H11N3OS
and a molecular weight of 221.28 g/mol. Its IUPAC name is S-(2-imidazo[1,2-a]pyrazin-2-ylethyl) ethanethioate.
Molecular Properties
| Compound Name | S-(2-imidazo[1,2-a]pyrazin-2-ylethyl) ethanethioate |
| PubChem CID | 21265894 |
| Molecular Formula | C10H11N3OS |
| Molecular Weight | 221.28 g/mol |
| Exact Mass | 221.06 |
| IUPAC Name | S-(2-imidazo[1,2-a]pyrazin-2-ylethyl) ethanethioate |
| SMILES | CC(=O)SCCc1cn2ccncc2n1 |
| InChI | InChI=1S/C10H11N3OS/c1-8(14)15-5-2-9-7-13-4-3-11-6-10(13)12-9/h3-4,6-7H,2,5H2,1H3 |
| InChIKey | SIYUZIQQPCVINH-UHFFFAOYSA-N |
| XLogP | 1.55 |
| TPSA | 47.26 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 15 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 221.28 |
| LogP ≤ 5 | 1.55 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'thioester', 'substructure': 'N/A'} |
|---|
Analyze S-(2-imidazo[1,2-a]pyrazin-2-ylethyl) ethanethioate with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of S-(2-imidazo[1,2-a]pyrazin-2-ylethyl) ethanethioate?
The IUPAC name of S-(2-imidazo[1,2-a]pyrazin-2-ylethyl) ethanethioate (CID 21265894) is S-(2-imidazo[1,2-a]pyrazin-2-ylethyl) ethanethioate.
What is the SMILES notation for S-(2-imidazo[1,2-a]pyrazin-2-ylethyl) ethanethioate?
The canonical SMILES for S-(2-imidazo[1,2-a]pyrazin-2-ylethyl) ethanethioate is CC(=O)SCCc1cn2ccncc2n1.
What is the InChIKey of S-(2-imidazo[1,2-a]pyrazin-2-ylethyl) ethanethioate?
The InChIKey is SIYUZIQQPCVINH-UHFFFAOYSA-N. The full InChI is InChI=1S/C10H11N3OS/c1-8(14)15-5-2-9-7-13-4-3-11-6-10(13)12-9/h3-4,6-7H,2,5H2,1H3.
What are the key properties of S-(2-imidazo[1,2-a]pyrazin-2-ylethyl) ethanethioate?
S-(2-imidazo[1,2-a]pyrazin-2-ylethyl) ethanethioate has a molecular weight of 221.28 g/mol, XLogP of 1.55, 3 rotatable bonds, 0 hydrogen bond donors, and 5 hydrogen bond acceptors.
Where does this data come from?
All data for S-(2-imidazo[1,2-a]pyrazin-2-ylethyl) ethanethioate is sourced from PubChem (CID 21265894), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).