About 2-imidazo[2,1-b][1,3,4]thiadiazol-6-ylethanol
2-imidazo[2,1-b][1,3,4]thiadiazol-6-ylethanol (PubChem CID 21265910) has the molecular formula C6H7N3OS
and a molecular weight of 169.21 g/mol. Its IUPAC name is 2-imidazo[2,1-b][1,3,4]thiadiazol-6-ylethanol.
Molecular Properties
| Compound Name | 2-imidazo[2,1-b][1,3,4]thiadiazol-6-ylethanol |
| PubChem CID | 21265910 |
| Molecular Formula | C6H7N3OS |
| Molecular Weight | 169.21 g/mol |
| Exact Mass | 169.03 |
| IUPAC Name | 2-imidazo[2,1-b][1,3,4]thiadiazol-6-ylethanol |
| SMILES | OCCc1cn2ncsc2n1 |
| InChI | InChI=1S/C6H7N3OS/c10-2-1-5-3-9-6(8-5)11-4-7-9/h3-4,10H,1-2H2 |
| InChIKey | GTWXADPBVUZYPV-UHFFFAOYSA-N |
| XLogP | 0.33 |
| TPSA | 50.42 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 11 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 169.21 |
| LogP ≤ 5 | 0.33 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
Analyze 2-imidazo[2,1-b][1,3,4]thiadiazol-6-ylethanol with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 2-imidazo[2,1-b][1,3,4]thiadiazol-6-ylethanol?
The IUPAC name of 2-imidazo[2,1-b][1,3,4]thiadiazol-6-ylethanol (CID 21265910) is 2-imidazo[2,1-b][1,3,4]thiadiazol-6-ylethanol.
What is the SMILES notation for 2-imidazo[2,1-b][1,3,4]thiadiazol-6-ylethanol?
The canonical SMILES for 2-imidazo[2,1-b][1,3,4]thiadiazol-6-ylethanol is OCCc1cn2ncsc2n1.
What is the InChIKey of 2-imidazo[2,1-b][1,3,4]thiadiazol-6-ylethanol?
The InChIKey is GTWXADPBVUZYPV-UHFFFAOYSA-N. The full InChI is InChI=1S/C6H7N3OS/c10-2-1-5-3-9-6(8-5)11-4-7-9/h3-4,10H,1-2H2.
What are the key properties of 2-imidazo[2,1-b][1,3,4]thiadiazol-6-ylethanol?
2-imidazo[2,1-b][1,3,4]thiadiazol-6-ylethanol has a molecular weight of 169.21 g/mol, XLogP of 0.33, 2 rotatable bonds, 1 hydrogen bond donors, and 5 hydrogen bond acceptors.
Where does this data come from?
All data for 2-imidazo[2,1-b][1,3,4]thiadiazol-6-ylethanol is sourced from PubChem (CID 21265910), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).