C15H11FIN3 — CID 21265962
5-(2-fluorophenyl)-7-iodo-3H-1,4-benzodiazepin-2-amine (PubChem CID 21265962) has the molecular formula C15H11FIN3 and a molecular weight of 379.18 g/mol. Its IUPAC name is 5-(2-fluorophenyl)-7-iodo-3H-1,4-benzodiazepin-2-amine.
| Compound Name | 5-(2-fluorophenyl)-7-iodo-3H-1,4-benzodiazepin-2-amine |
|---|---|
| PubChem CID | 21265962 |
| Molecular Formula | C15H11FIN3 |
| Molecular Weight | 379.18 g/mol |
| Exact Mass | 379.00 |
| IUPAC Name | 5-(2-fluorophenyl)-7-iodo-3H-1,4-benzodiazepin-2-amine |
| SMILES | NC1=Nc2ccc(I)cc2C(c2ccccc2F)=NC1 |
| InChI | InChI=1S/C15H11FIN3/c16-12-4-2-1-3-10(12)15-11-7-9(17)5-6-13(11)20-14(18)8-19-15/h1-7H,8H2,(H2,18,20) |
| InChIKey | LFUZDRQQAFRINX-UHFFFAOYSA-N |
| XLogP | 3.27 |
| TPSA | 50.74 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 379.18 |
| LogP ≤ 5 | 3.27 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'iodine', 'substructure': 'N/A'} |
|---|