About N-ethylethanamine;2-methylpentane-1,5-diol
N-ethylethanamine;2-methylpentane-1,5-diol (PubChem CID 21266709) has the molecular formula C10H25NO2
and a molecular weight of 191.31 g/mol. Its IUPAC name is N-ethylethanamine;2-methylpentane-1,5-diol.
Molecular Properties
| Compound Name | N-ethylethanamine;2-methylpentane-1,5-diol |
| PubChem CID | 21266709 |
| Molecular Formula | C10H25NO2 |
| Molecular Weight | 191.31 g/mol |
| Exact Mass | 191.19 |
| IUPAC Name | N-ethylethanamine;2-methylpentane-1,5-diol |
| SMILES | CC(CO)CCCO.CCNCC |
| InChI | InChI=1S/C6H14O2.C4H11N/c1-6(5-8)3-2-4-7;1-3-5-4-2/h6-8H,2-5H2,1H3;5H,3-4H2,1-2H3 |
| InChIKey | VRAPMWYTCANIAN-UHFFFAOYSA-N |
| XLogP | 1.00 |
| TPSA | 52.49 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 13 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 191.31 |
| LogP ≤ 5 | 1.00 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 3 |
Analyze N-ethylethanamine;2-methylpentane-1,5-diol with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of N-ethylethanamine;2-methylpentane-1,5-diol?
The IUPAC name of N-ethylethanamine;2-methylpentane-1,5-diol (CID 21266709) is N-ethylethanamine;2-methylpentane-1,5-diol.
What is the SMILES notation for N-ethylethanamine;2-methylpentane-1,5-diol?
The canonical SMILES for N-ethylethanamine;2-methylpentane-1,5-diol is CC(CO)CCCO.CCNCC.
What is the InChIKey of N-ethylethanamine;2-methylpentane-1,5-diol?
The InChIKey is VRAPMWYTCANIAN-UHFFFAOYSA-N. The full InChI is InChI=1S/C6H14O2.C4H11N/c1-6(5-8)3-2-4-7;1-3-5-4-2/h6-8H,2-5H2,1H3;5H,3-4H2,1-2H3.
What are the key properties of N-ethylethanamine;2-methylpentane-1,5-diol?
N-ethylethanamine;2-methylpentane-1,5-diol has a molecular weight of 191.31 g/mol, XLogP of 1.00, 6 rotatable bonds, 3 hydrogen bond donors, and 3 hydrogen bond acceptors.
Where does this data come from?
All data for N-ethylethanamine;2-methylpentane-1,5-diol is sourced from PubChem (CID 21266709), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).