C17H18O5 — CID 21269133
2-[[4-(carboxymethyl)phenoxy]methyl]benzoic acid;methane (PubChem CID 21269133) has the molecular formula C17H18O5 and a molecular weight of 302.33 g/mol. Its IUPAC name is 2-[[4-(carboxymethyl)phenoxy]methyl]benzoic acid;methane.
| Compound Name | 2-[[4-(carboxymethyl)phenoxy]methyl]benzoic acid;methane |
|---|---|
| PubChem CID | 21269133 |
| Molecular Formula | C17H18O5 |
| Molecular Weight | 302.33 g/mol |
| Exact Mass | 302.12 |
| IUPAC Name | 2-[[4-(carboxymethyl)phenoxy]methyl]benzoic acid;methane |
| SMILES | C.O=C(O)Cc1ccc(OCc2ccccc2C(=O)O)cc1 |
| InChI | InChI=1S/C16H14O5.CH4/c17-15(18)9-11-5-7-13(8-6-11)21-10-12-3-1-2-4-14(12)16(19)20;/h1-8H,9-10H2,(H,17,18)(H,19,20);1H4 |
| InChIKey | OTTWGOWCSPXQNQ-UHFFFAOYSA-N |
| XLogP | 3.23 |
| TPSA | 83.83 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 22 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 302.33 |
| LogP ≤ 5 | 3.23 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |