About 1-hydroxyethyl N-methylcarbamate
1-hydroxyethyl N-methylcarbamate (PubChem CID 21270273) has the molecular formula C4H9NO3
and a molecular weight of 119.12 g/mol. Its IUPAC name is 1-hydroxyethyl N-methylcarbamate.
Molecular Properties
| Compound Name | 1-hydroxyethyl N-methylcarbamate |
| PubChem CID | 21270273 |
| Molecular Formula | C4H9NO3 |
| Molecular Weight | 119.12 g/mol |
| Exact Mass | 119.06 |
| IUPAC Name | 1-hydroxyethyl N-methylcarbamate |
| SMILES | CNC(=O)OC(C)O |
| InChI | InChI=1S/C4H9NO3/c1-3(6)8-4(7)5-2/h3,6H,1-2H3,(H,5,7) |
| InChIKey | OJJWLXAHUXVAQG-UHFFFAOYSA-N |
| XLogP | -0.32 |
| TPSA | 58.56 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 8 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 119.12 |
| LogP ≤ 5 | -0.32 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'het-C-het_not_in_ring', 'substructure': 'N/A'} |
|---|
Analyze 1-hydroxyethyl N-methylcarbamate with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 1-hydroxyethyl N-methylcarbamate?
The IUPAC name of 1-hydroxyethyl N-methylcarbamate (CID 21270273) is 1-hydroxyethyl N-methylcarbamate.
What is the SMILES notation for 1-hydroxyethyl N-methylcarbamate?
The canonical SMILES for 1-hydroxyethyl N-methylcarbamate is CNC(=O)OC(C)O.
What is the InChIKey of 1-hydroxyethyl N-methylcarbamate?
The InChIKey is OJJWLXAHUXVAQG-UHFFFAOYSA-N. The full InChI is InChI=1S/C4H9NO3/c1-3(6)8-4(7)5-2/h3,6H,1-2H3,(H,5,7).
What are the key properties of 1-hydroxyethyl N-methylcarbamate?
1-hydroxyethyl N-methylcarbamate has a molecular weight of 119.12 g/mol, XLogP of -0.32, 1 rotatable bonds, 2 hydrogen bond donors, and 3 hydrogen bond acceptors.
Where does this data come from?
All data for 1-hydroxyethyl N-methylcarbamate is sourced from PubChem (CID 21270273), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).