C16H14ClN3O — CID 21270420
4-(4-chlorophenyl)-11-methyl-3,4,8-triazatricyclo[7.3.0.02,6]dodeca-1,6,8-trien-5-one (PubChem CID 21270420) has the molecular formula C16H14ClN3O and a molecular weight of 299.76 g/mol. Its IUPAC name is 4-(4-chlorophenyl)-11-methyl-3,4,8-triazatricyclo[7.3.0.02,6]dodeca-1,6,8-trien-5-one.
| Compound Name | 4-(4-chlorophenyl)-11-methyl-3,4,8-triazatricyclo[7.3.0.02,6]dodeca-1,6,8-trien-5-one |
|---|---|
| PubChem CID | 21270420 |
| Molecular Formula | C16H14ClN3O |
| Molecular Weight | 299.76 g/mol |
| Exact Mass | 299.08 |
| IUPAC Name | 4-(4-chlorophenyl)-11-methyl-3,4,8-triazatricyclo[7.3.0.02,6]dodeca-1,6,8-trien-5-one |
| SMILES | CC1Cc2ncc3c(=O)n(-c4ccc(Cl)cc4)[nH]c3c2C1 |
| InChI | InChI=1S/C16H14ClN3O/c1-9-6-12-14(7-9)18-8-13-15(12)19-20(16(13)21)11-4-2-10(17)3-5-11/h2-5,8-9,19H,6-7H2,1H3 |
| InChIKey | YHCGMMUSHNUVGS-UHFFFAOYSA-N |
| XLogP | 3.10 |
| TPSA | 50.68 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 299.76 |
| LogP ≤ 5 | 3.10 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'het_65_B(7)', 'substructure': 'N/A'} |
|---|