C16H10Cl2F6N2O3 — CID 21270698
propan-2-yl 2-chloro-5-[2-chloro-6-oxo-4-(1,1,2,2,2-pentafluoroethyl)pyrimidin-1-yl]-4-fluorobenzoate (PubChem CID 21270698) has the molecular formula C16H10Cl2F6N2O3 and a molecular weight of 463.16 g/mol. Its IUPAC name is propan-2-yl 2-chloro-5-[2-chloro-6-oxo-4-(1,1,2,2,2-pentafluoroethyl)pyrimidin-1-yl]-4-fluorobenzoate.
| Compound Name | propan-2-yl 2-chloro-5-[2-chloro-6-oxo-4-(1,1,2,2,2-pentafluoroethyl)pyrimidin-1-yl]-4-fluorobenzoate |
|---|---|
| PubChem CID | 21270698 |
| Molecular Formula | C16H10Cl2F6N2O3 |
| Molecular Weight | 463.16 g/mol |
| Exact Mass | 462.00 |
| IUPAC Name | propan-2-yl 2-chloro-5-[2-chloro-6-oxo-4-(1,1,2,2,2-pentafluoroethyl)pyrimidin-1-yl]-4-fluorobenzoate |
| SMILES | CC(C)OC(=O)c1cc(-n2c(Cl)nc(C(F)(F)C(F)(F)F)cc2=O)c(F)cc1Cl |
| InChI | InChI=1S/C16H10Cl2F6N2O3/c1-6(2)29-13(28)7-3-10(9(19)4-8(7)17)26-12(27)5-11(25-14(26)18)15(20,21)16(22,23)24/h3-6H,1-2H3 |
| InChIKey | CFFPSLOMCUTCAP-UHFFFAOYSA-N |
| XLogP | 4.90 |
| TPSA | 61.19 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 29 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 463.16 |
| LogP ≤ 5 | 4.90 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Perfluorinated_chain', 'substructure': 'N/A'} |
|---|