C18H13ClF6N2O3 — CID 21270770
3-(4-chloro-2-fluoro-5-prop-2-ynoxyphenyl)-6-(1,1,2,2,2-pentafluoroethyl)-2-propoxypyrimidin-4-one (PubChem CID 21270770) has the molecular formula C18H13ClF6N2O3 and a molecular weight of 454.75 g/mol. Its IUPAC name is 3-(4-chloro-2-fluoro-5-prop-2-ynoxyphenyl)-6-(1,1,2,2,2-pentafluoroethyl)-2-propoxypyrimidin-4-one.
| Compound Name | 3-(4-chloro-2-fluoro-5-prop-2-ynoxyphenyl)-6-(1,1,2,2,2-pentafluoroethyl)-2-propoxypyrimidin-4-one |
|---|---|
| PubChem CID | 21270770 |
| Molecular Formula | C18H13ClF6N2O3 |
| Molecular Weight | 454.75 g/mol |
| Exact Mass | 454.05 |
| IUPAC Name | 3-(4-chloro-2-fluoro-5-prop-2-ynoxyphenyl)-6-(1,1,2,2,2-pentafluoroethyl)-2-propoxypyrimidin-4-one |
| SMILES | C#CCOc1cc(-n2c(OCCC)nc(C(F)(F)C(F)(F)F)cc2=O)c(F)cc1Cl |
| InChI | InChI=1S/C18H13ClF6N2O3/c1-3-5-29-13-8-12(11(20)7-10(13)19)27-15(28)9-14(17(21,22)18(23,24)25)26-16(27)30-6-4-2/h1,7-9H,4-6H2,2H3 |
| InChIKey | ZBXVGVYVJWKHMQ-UHFFFAOYSA-N |
| XLogP | 4.48 |
| TPSA | 53.35 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 30 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 454.75 |
| LogP ≤ 5 | 4.48 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Perfluorinated_chain', 'substructure': 'N/A'}, {'alert_name': 'triple_bond', 'substructure': 'N/A'} |
|---|