About ethyl 2-hydroxy-2-(1,2-thiazol-5-yl)ethanimidate;hydrochloride
ethyl 2-hydroxy-2-(1,2-thiazol-5-yl)ethanimidate;hydrochloride (PubChem CID 21271228) has the molecular formula C7H11ClN2O2S
and a molecular weight of 222.70 g/mol. Its IUPAC name is ethyl 2-hydroxy-2-(1,2-thiazol-5-yl)ethanimidate;hydrochloride.
Molecular Properties
| Compound Name | ethyl 2-hydroxy-2-(1,2-thiazol-5-yl)ethanimidate;hydrochloride |
| PubChem CID | 21271228 |
| Molecular Formula | C7H11ClN2O2S |
| Molecular Weight | 222.70 g/mol |
| Exact Mass | 222.02 |
| IUPAC Name | ethyl 2-hydroxy-2-(1,2-thiazol-5-yl)ethanimidate;hydrochloride |
| SMILES | Cl.[H]/N=C(\OCC)C(O)c1ccns1 |
| InChI | InChI=1S/C7H10N2O2S.ClH/c1-2-11-7(8)6(10)5-3-4-9-12-5;/h3-4,6,8,10H,2H2,1H3;1H/b8-7-; |
| InChIKey | ICFGZPRDSWOEAD-CFYXSCKTSA-N |
| XLogP | 1.61 |
| TPSA | 66.20 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 13 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 222.70 |
| LogP ≤ 5 | 1.61 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'} |
|---|
Analyze ethyl 2-hydroxy-2-(1,2-thiazol-5-yl)ethanimidate;hydrochloride with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of ethyl 2-hydroxy-2-(1,2-thiazol-5-yl)ethanimidate;hydrochloride?
The IUPAC name of ethyl 2-hydroxy-2-(1,2-thiazol-5-yl)ethanimidate;hydrochloride (CID 21271228) is ethyl 2-hydroxy-2-(1,2-thiazol-5-yl)ethanimidate;hydrochloride.
What is the SMILES notation for ethyl 2-hydroxy-2-(1,2-thiazol-5-yl)ethanimidate;hydrochloride?
The canonical SMILES for ethyl 2-hydroxy-2-(1,2-thiazol-5-yl)ethanimidate;hydrochloride is Cl.[H]/N=C(\OCC)C(O)c1ccns1.
What is the InChIKey of ethyl 2-hydroxy-2-(1,2-thiazol-5-yl)ethanimidate;hydrochloride?
The InChIKey is ICFGZPRDSWOEAD-CFYXSCKTSA-N. The full InChI is InChI=1S/C7H10N2O2S.ClH/c1-2-11-7(8)6(10)5-3-4-9-12-5;/h3-4,6,8,10H,2H2,1H3;1H/b8-7-;.
What are the key properties of ethyl 2-hydroxy-2-(1,2-thiazol-5-yl)ethanimidate;hydrochloride?
ethyl 2-hydroxy-2-(1,2-thiazol-5-yl)ethanimidate;hydrochloride has a molecular weight of 222.70 g/mol, XLogP of 1.61, 3 rotatable bonds, 2 hydrogen bond donors, and 5 hydrogen bond acceptors.
Where does this data come from?
All data for ethyl 2-hydroxy-2-(1,2-thiazol-5-yl)ethanimidate;hydrochloride is sourced from PubChem (CID 21271228), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).