2,2-bis(prop-2-enyl)morpholin-4-ium chloride

C10H18ClNO — CID 21271342

IUPAC2,2-bis(prop-2-enyl)morpholin-4-ium chloride
SMILESC=CCC1(CC=C)C[NH2+]CCO1.[Cl-]
InChIInChI=1S/C10H17NO.ClH/c1-3-5-10(6-4-2)9-11-7-8-12-10;/h3-4,11H,1-2,5-9H2;1H
InChIKeyQJEASSKUGZDRJM-UHFFFAOYSA-N
MW203.71 g/mol
LogP-2.53
Rot. Bonds4

About 2,2-bis(prop-2-enyl)morpholin-4-ium chloride

2,2-bis(prop-2-enyl)morpholin-4-ium chloride (PubChem CID 21271342) has the molecular formula C10H18ClNO and a molecular weight of 203.71 g/mol. Its IUPAC name is 2,2-bis(prop-2-enyl)morpholin-4-ium chloride.

Molecular Properties

Compound Name2,2-bis(prop-2-enyl)morpholin-4-ium chloride
PubChem CID21271342
Molecular FormulaC10H18ClNO
Molecular Weight203.71 g/mol
Exact Mass203.11
IUPAC Name2,2-bis(prop-2-enyl)morpholin-4-ium chloride
SMILESC=CCC1(CC=C)C[NH2+]CCO1.[Cl-]
InChIInChI=1S/C10H17NO.ClH/c1-3-5-10(6-4-2)9-11-7-8-12-10;/h3-4,11H,1-2,5-9H2;1H
InChIKeyQJEASSKUGZDRJM-UHFFFAOYSA-N
XLogP-2.53
TPSA25.84 Ų
H-Bond Donors1
H-Bond Acceptors1
Rotatable Bonds4
Heavy Atoms13
Complexity—

Lipinski Rule of Five

Passes Rule of Five

RuleValue
MW ≤ 500203.71
LogP ≤ 5-2.53
H-Bond Donors ≤ 51
H-Bond Acceptors ≤ 101

Computed Properties (RDKit)

Structural Alerts{'alert_name': 'isolated_alkene', 'substructure': 'N/A'}

Analyze 2,2-bis(prop-2-enyl)morpholin-4-ium chloride with MolForge

Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.

Launch Full Analysis

Frequently Asked Questions

What is the IUPAC name of 2,2-bis(prop-2-enyl)morpholin-4-ium chloride?
The IUPAC name of 2,2-bis(prop-2-enyl)morpholin-4-ium chloride (CID 21271342) is 2,2-bis(prop-2-enyl)morpholin-4-ium chloride.
What is the SMILES notation for 2,2-bis(prop-2-enyl)morpholin-4-ium chloride?
The canonical SMILES for 2,2-bis(prop-2-enyl)morpholin-4-ium chloride is C=CCC1(CC=C)C[NH2+]CCO1.[Cl-].
What is the InChIKey of 2,2-bis(prop-2-enyl)morpholin-4-ium chloride?
The InChIKey is QJEASSKUGZDRJM-UHFFFAOYSA-N. The full InChI is InChI=1S/C10H17NO.ClH/c1-3-5-10(6-4-2)9-11-7-8-12-10;/h3-4,11H,1-2,5-9H2;1H.
What are the key properties of 2,2-bis(prop-2-enyl)morpholin-4-ium chloride?
2,2-bis(prop-2-enyl)morpholin-4-ium chloride has a molecular weight of 203.71 g/mol, XLogP of -2.53, 4 rotatable bonds, 1 hydrogen bond donors, and 1 hydrogen bond acceptors.
Where does this data come from?
All data for 2,2-bis(prop-2-enyl)morpholin-4-ium chloride is sourced from PubChem (CID 21271342), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).