About N'-[(4,6-difluoro-3-pyridinyl)methyl]ethane-1,2-diamine
N'-[(4,6-difluoro-3-pyridinyl)methyl]ethane-1,2-diamine (PubChem CID 21271663) has the molecular formula C8H11F2N3
and a molecular weight of 187.19 g/mol. Its IUPAC name is N'-[(4,6-difluoro-3-pyridinyl)methyl]ethane-1,2-diamine.
Molecular Properties
| Compound Name | N'-[(4,6-difluoro-3-pyridinyl)methyl]ethane-1,2-diamine |
| PubChem CID | 21271663 |
| Molecular Formula | C8H11F2N3 |
| Molecular Weight | 187.19 g/mol |
| Exact Mass | 187.09 |
| IUPAC Name | N'-[(4,6-difluoro-3-pyridinyl)methyl]ethane-1,2-diamine |
| SMILES | NCCNCc1cnc(F)cc1F |
| InChI | InChI=1S/C8H11F2N3/c9-7-3-8(10)13-5-6(7)4-12-2-1-11/h3,5,12H,1-2,4,11H2 |
| InChIKey | CPZOIVXPJWXWEU-UHFFFAOYSA-N |
| XLogP | 0.41 |
| TPSA | 50.94 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 13 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 187.19 |
| LogP ≤ 5 | 0.41 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': '2-halo_pyridine', 'substructure': 'N/A'}, {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|
Analyze N'-[(4,6-difluoro-3-pyridinyl)methyl]ethane-1,2-diamine with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of N'-[(4,6-difluoro-3-pyridinyl)methyl]ethane-1,2-diamine?
The IUPAC name of N'-[(4,6-difluoro-3-pyridinyl)methyl]ethane-1,2-diamine (CID 21271663) is N'-[(4,6-difluoro-3-pyridinyl)methyl]ethane-1,2-diamine.
What is the SMILES notation for N'-[(4,6-difluoro-3-pyridinyl)methyl]ethane-1,2-diamine?
The canonical SMILES for N'-[(4,6-difluoro-3-pyridinyl)methyl]ethane-1,2-diamine is NCCNCc1cnc(F)cc1F.
What is the InChIKey of N'-[(4,6-difluoro-3-pyridinyl)methyl]ethane-1,2-diamine?
The InChIKey is CPZOIVXPJWXWEU-UHFFFAOYSA-N. The full InChI is InChI=1S/C8H11F2N3/c9-7-3-8(10)13-5-6(7)4-12-2-1-11/h3,5,12H,1-2,4,11H2.
What are the key properties of N'-[(4,6-difluoro-3-pyridinyl)methyl]ethane-1,2-diamine?
N'-[(4,6-difluoro-3-pyridinyl)methyl]ethane-1,2-diamine has a molecular weight of 187.19 g/mol, XLogP of 0.41, 4 rotatable bonds, 2 hydrogen bond donors, and 3 hydrogen bond acceptors.
Where does this data come from?
All data for N'-[(4,6-difluoro-3-pyridinyl)methyl]ethane-1,2-diamine is sourced from PubChem (CID 21271663), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).