About pyrrole-2,5-dione
pyrrole-2,5-dione (PubChem CID 21271766) has the molecular formula C12H9N3O6
and a molecular weight of 291.22 g/mol. Its IUPAC name is pyrrole-2,5-dione.
Molecular Properties
| Compound Name | pyrrole-2,5-dione |
| PubChem CID | 21271766 |
| Molecular Formula | C12H9N3O6 |
| Molecular Weight | 291.22 g/mol |
| Exact Mass | 291.05 |
| IUPAC Name | pyrrole-2,5-dione |
| SMILES | O=C1C=CC(=O)N1.O=C1C=CC(=O)N1.O=C1C=CC(=O)N1 |
| InChI | InChI=1S/3C4H3NO2/c3*6-3-1-2-4(7)5-3/h3*1-2H,(H,5,6,7) |
| InChIKey | WHSIWXIKBLQGIZ-UHFFFAOYSA-N |
| XLogP | -2.40 |
| TPSA | 138.51 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | |
| Heavy Atoms | 21 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 291.22 |
| LogP ≤ 5 | -2.40 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 6 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'phthalimide', 'substructure': 'N/A'} |
|---|
Analyze pyrrole-2,5-dione with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of pyrrole-2,5-dione?
The IUPAC name of pyrrole-2,5-dione (CID 21271766) is pyrrole-2,5-dione.
What is the SMILES notation for pyrrole-2,5-dione?
The canonical SMILES for pyrrole-2,5-dione is O=C1C=CC(=O)N1.O=C1C=CC(=O)N1.O=C1C=CC(=O)N1.
What is the InChIKey of pyrrole-2,5-dione?
The InChIKey is WHSIWXIKBLQGIZ-UHFFFAOYSA-N. The full InChI is InChI=1S/3C4H3NO2/c3*6-3-1-2-4(7)5-3/h3*1-2H,(H,5,6,7).
What are the key properties of pyrrole-2,5-dione?
pyrrole-2,5-dione has a molecular weight of 291.22 g/mol, XLogP of -2.40, 0 rotatable bonds, 3 hydrogen bond donors, and 6 hydrogen bond acceptors.
Where does this data come from?
All data for pyrrole-2,5-dione is sourced from PubChem (CID 21271766), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).