C31H46O4 — CID 21271940
benzyl 4-(3,12-dihydroxy-10,13-dimethyl-2,3,4,5,6,7,8,9,11,12,14,15,16,17-tetradecahydro-1H-cyclopenta[a]phenanthren-17-yl)pentanoate (PubChem CID 21271940) has the molecular formula C31H46O4 and a molecular weight of 482.71 g/mol. Its IUPAC name is benzyl 4-(3,12-dihydroxy-10,13-dimethyl-2,3,4,5,6,7,8,9,11,12,14,15,16,17-tetradecahydro-1H-cyclopenta[a]phenanthren-17-yl)pentanoate.
| Compound Name | benzyl 4-(3,12-dihydroxy-10,13-dimethyl-2,3,4,5,6,7,8,9,11,12,14,15,16,17-tetradecahydro-1H-cyclopenta[a]phenanthren-17-yl)pentanoate |
|---|---|
| PubChem CID | 21271940 |
| Molecular Formula | C31H46O4 |
| Molecular Weight | 482.71 g/mol |
| Exact Mass | 482.34 |
| IUPAC Name | benzyl 4-(3,12-dihydroxy-10,13-dimethyl-2,3,4,5,6,7,8,9,11,12,14,15,16,17-tetradecahydro-1H-cyclopenta[a]phenanthren-17-yl)pentanoate |
| SMILES | CC(CCC(=O)OCc1ccccc1)C1CCC2C3CCC4CC(O)CCC4(C)C3CC(O)C12C |
| InChI | InChI=1S/C31H46O4/c1-20(9-14-29(34)35-19-21-7-5-4-6-8-21)25-12-13-26-24-11-10-22-17-23(32)15-16-30(22,2)27(24)18-28(33)31(25,26)3/h4-8,20,22-28,32-33H,9-19H2,1-3H3 |
| InChIKey | YPVJNCSIDBHSNW-UHFFFAOYSA-N |
| XLogP | 6.14 |
| TPSA | 66.76 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 35 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 482.71 |
| LogP ≤ 5 | 6.14 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |