About benzenesulfonylbenzene;sulfane
benzenesulfonylbenzene;sulfane (PubChem CID 21271998) has the molecular formula C24H22O4S3
and a molecular weight of 470.64 g/mol. Its IUPAC name is benzenesulfonylbenzene;sulfane.
Molecular Properties
| Compound Name | benzenesulfonylbenzene;sulfane |
| PubChem CID | 21271998 |
| Molecular Formula | C24H22O4S3 |
| Molecular Weight | 470.64 g/mol |
| Exact Mass | 470.07 |
| IUPAC Name | benzenesulfonylbenzene;sulfane |
| SMILES | O=S(=O)(c1ccccc1)c1ccccc1.O=S(=O)(c1ccccc1)c1ccccc1.S |
| InChI | InChI=1S/2C12H10O2S.H2S/c2*13-15(14,11-7-3-1-4-8-11)12-9-5-2-6-10-12;/h2*1-10H;1H2 |
| InChIKey | KMDAMPQVHWRQIB-UHFFFAOYSA-N |
| XLogP | 5.15 |
| TPSA | 68.28 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 31 |
| Complexity | — |
Lipinski Rule of Five
1 violation
| Rule | Value |
| MW ≤ 500 | 470.64 |
| LogP ≤ 5 | 5.15 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
Analyze benzenesulfonylbenzene;sulfane with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of benzenesulfonylbenzene;sulfane?
The IUPAC name of benzenesulfonylbenzene;sulfane (CID 21271998) is benzenesulfonylbenzene;sulfane.
What is the SMILES notation for benzenesulfonylbenzene;sulfane?
The canonical SMILES for benzenesulfonylbenzene;sulfane is O=S(=O)(c1ccccc1)c1ccccc1.O=S(=O)(c1ccccc1)c1ccccc1.S.
What is the InChIKey of benzenesulfonylbenzene;sulfane?
The InChIKey is KMDAMPQVHWRQIB-UHFFFAOYSA-N. The full InChI is InChI=1S/2C12H10O2S.H2S/c2*13-15(14,11-7-3-1-4-8-11)12-9-5-2-6-10-12;/h2*1-10H;1H2.
What are the key properties of benzenesulfonylbenzene;sulfane?
benzenesulfonylbenzene;sulfane has a molecular weight of 470.64 g/mol, XLogP of 5.15, 4 rotatable bonds, 0 hydrogen bond donors, and 4 hydrogen bond acceptors.
Where does this data come from?
All data for benzenesulfonylbenzene;sulfane is sourced from PubChem (CID 21271998), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).