C18H14F3N3O5S — CID 21272686
[3-methoxy-4-(7-methyl-6-oxo-5,7-dihydro-1H-pyrrolo[2,3-f]benzimidazol-2-yl)phenyl] trifluoromethanesulfonate (PubChem CID 21272686) has the molecular formula C18H14F3N3O5S and a molecular weight of 441.39 g/mol. Its IUPAC name is [3-methoxy-4-(7-methyl-6-oxo-5,7-dihydro-1H-pyrrolo[2,3-f]benzimidazol-2-yl)phenyl] trifluoromethanesulfonate.
| Compound Name | [3-methoxy-4-(7-methyl-6-oxo-5,7-dihydro-1H-pyrrolo[2,3-f]benzimidazol-2-yl)phenyl] trifluoromethanesulfonate |
|---|---|
| PubChem CID | 21272686 |
| Molecular Formula | C18H14F3N3O5S |
| Molecular Weight | 441.39 g/mol |
| Exact Mass | 441.06 |
| IUPAC Name | [3-methoxy-4-(7-methyl-6-oxo-5,7-dihydro-1H-pyrrolo[2,3-f]benzimidazol-2-yl)phenyl] trifluoromethanesulfonate |
| SMILES | COc1cc(OS(=O)(=O)C(F)(F)F)ccc1-c1nc2cc3c(cc2[nH]1)C(C)C(=O)N3 |
| InChI | InChI=1S/C18H14F3N3O5S/c1-8-11-6-13-14(7-12(11)24-17(8)25)23-16(22-13)10-4-3-9(5-15(10)28-2)29-30(26,27)18(19,20)21/h3-8H,1-2H3,(H,22,23)(H,24,25) |
| InChIKey | HSYJISVMDJEAMO-UHFFFAOYSA-N |
| XLogP | 3.52 |
| TPSA | 110.38 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 30 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 441.39 |
| LogP ≤ 5 | 3.52 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'Sulfonic_acid_1', 'substructure': 'N/A'}, {'alert_name': 'triflate', 'substructure': 'N/A'} |
|---|