C31H40O2S — CID 21272778
ethyl 2-[4-[2-(4,4-dimethyl-7-pentyl-2,3-dihydrothiochromen-6-yl)ethynyl]phenyl]pentanoate (PubChem CID 21272778) has the molecular formula C31H40O2S and a molecular weight of 476.73 g/mol. Its IUPAC name is ethyl 2-[4-[2-(4,4-dimethyl-7-pentyl-2,3-dihydrothiochromen-6-yl)ethynyl]phenyl]pentanoate.
| Compound Name | ethyl 2-[4-[2-(4,4-dimethyl-7-pentyl-2,3-dihydrothiochromen-6-yl)ethynyl]phenyl]pentanoate |
|---|---|
| PubChem CID | 21272778 |
| Molecular Formula | C31H40O2S |
| Molecular Weight | 476.73 g/mol |
| Exact Mass | 476.27 |
| IUPAC Name | ethyl 2-[4-[2-(4,4-dimethyl-7-pentyl-2,3-dihydrothiochromen-6-yl)ethynyl]phenyl]pentanoate |
| SMILES | CCCCCc1cc2c(cc1C#Cc1ccc(C(CCC)C(=O)OCC)cc1)C(C)(C)CCS2 |
| InChI | InChI=1S/C31H40O2S/c1-6-9-10-12-25-22-29-28(31(4,5)19-20-34-29)21-26(25)18-15-23-13-16-24(17-14-23)27(11-7-2)30(32)33-8-3/h13-14,16-17,21-22,27H,6-12,19-20H2,1-5H3 |
| InChIKey | ZJOSBMNLWLTGNN-UHFFFAOYSA-N |
| XLogP | 8.04 |
| TPSA | 26.30 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 34 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 476.73 |
| LogP ≤ 5 | 8.04 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'triple_bond', 'substructure': 'N/A'} |
|---|