C48H44Cl4N2O2 — CID 21273043
4,5,6,7-tetrachloro-3,3-bis[(E)-2-(4-ethylphenyl)-2-(4-pyrrolidin-1-ylphenyl)ethenyl]-2-benzofuran-1-one (PubChem CID 21273043) has the molecular formula C48H44Cl4N2O2 and a molecular weight of 822.70 g/mol. Its IUPAC name is 4,5,6,7-tetrachloro-3,3-bis[(E)-2-(4-ethylphenyl)-2-(4-pyrrolidin-1-ylphenyl)ethenyl]-2-benzofuran-1-one.
| Compound Name | 4,5,6,7-tetrachloro-3,3-bis[(E)-2-(4-ethylphenyl)-2-(4-pyrrolidin-1-ylphenyl)ethenyl]-2-benzofuran-1-one |
|---|---|
| PubChem CID | 21273043 |
| Molecular Formula | C48H44Cl4N2O2 |
| Molecular Weight | 822.70 g/mol |
| Exact Mass | 820.22 |
| IUPAC Name | 4,5,6,7-tetrachloro-3,3-bis[(E)-2-(4-ethylphenyl)-2-(4-pyrrolidin-1-ylphenyl)ethenyl]-2-benzofuran-1-one |
| SMILES | CCc1ccc(/C(=C\C2(/C=C(\c3ccc(CC)cc3)c3ccc(N4CCCC4)cc3)OC(=O)c3c(Cl)c(Cl)c(Cl)c(Cl)c32)c2ccc(N3CCCC3)cc2)cc1 |
| InChI | InChI=1S/C48H44Cl4N2O2/c1-3-31-9-13-33(14-10-31)39(35-17-21-37(22-18-35)53-25-5-6-26-53)29-48(42-41(47(55)56-48)43(49)45(51)46(52)44(42)50)30-40(34-15-11-32(4-2)12-16-34)36-19-23-38(24-20-36)54-27-7-8-28-54/h9-24,29-30H,3-8,25-28H2,1-2H3/b39-29+,40-30+ |
| InChIKey | VDMXAQXJQAVQJM-NXRKLTDKSA-N |
| XLogP | 13.25 |
| TPSA | 32.78 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 56 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 822.70 |
| LogP ≤ 5 | 13.25 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'anil_di_alk_B(251)', 'substructure': 'N/A'}, {'alert_name': 'halogenated_ring_1', 'substructure': 'N/A'}, {'alert_name': 'halogenated_ring_2', 'substructure': 'N/A'} |
|---|