About 5-fluoro-3-methyl-1,3-dihydroindole-2-thione
5-fluoro-3-methyl-1,3-dihydroindole-2-thione (PubChem CID 21273363) has the molecular formula C9H8FNS
and a molecular weight of 181.23 g/mol. Its IUPAC name is 5-fluoro-3-methyl-1,3-dihydroindole-2-thione.
Molecular Properties
| Compound Name | 5-fluoro-3-methyl-1,3-dihydroindole-2-thione |
| PubChem CID | 21273363 |
| Molecular Formula | C9H8FNS |
| Molecular Weight | 181.23 g/mol |
| Exact Mass | 181.04 |
| IUPAC Name | 5-fluoro-3-methyl-1,3-dihydroindole-2-thione |
| SMILES | CC1C(=S)Nc2ccc(F)cc21 |
| InChI | InChI=1S/C9H8FNS/c1-5-7-4-6(10)2-3-8(7)11-9(5)12/h2-5H,1H3,(H,11,12) |
| InChIKey | FIWADZAJMKCAHJ-UHFFFAOYSA-N |
| XLogP | 2.68 |
| TPSA | 12.03 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | |
| Heavy Atoms | 12 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 181.23 |
| LogP ≤ 5 | 2.68 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 1 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'Thiocarbonyl_group', 'substructure': 'N/A'} |
|---|
Analyze 5-fluoro-3-methyl-1,3-dihydroindole-2-thione with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 5-fluoro-3-methyl-1,3-dihydroindole-2-thione?
The IUPAC name of 5-fluoro-3-methyl-1,3-dihydroindole-2-thione (CID 21273363) is 5-fluoro-3-methyl-1,3-dihydroindole-2-thione.
What is the SMILES notation for 5-fluoro-3-methyl-1,3-dihydroindole-2-thione?
The canonical SMILES for 5-fluoro-3-methyl-1,3-dihydroindole-2-thione is CC1C(=S)Nc2ccc(F)cc21.
What is the InChIKey of 5-fluoro-3-methyl-1,3-dihydroindole-2-thione?
The InChIKey is FIWADZAJMKCAHJ-UHFFFAOYSA-N. The full InChI is InChI=1S/C9H8FNS/c1-5-7-4-6(10)2-3-8(7)11-9(5)12/h2-5H,1H3,(H,11,12).
What are the key properties of 5-fluoro-3-methyl-1,3-dihydroindole-2-thione?
5-fluoro-3-methyl-1,3-dihydroindole-2-thione has a molecular weight of 181.23 g/mol, XLogP of 2.68, 0 rotatable bonds, 1 hydrogen bond donors, and 1 hydrogen bond acceptors.
Where does this data come from?
All data for 5-fluoro-3-methyl-1,3-dihydroindole-2-thione is sourced from PubChem (CID 21273363), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).