About 2-methoxycyclohexa-2,4-diene-1-thione
2-methoxycyclohexa-2,4-diene-1-thione (PubChem CID 21273364) has the molecular formula C7H8OS
and a molecular weight of 140.21 g/mol. Its IUPAC name is 2-methoxycyclohexa-2,4-diene-1-thione.
Molecular Properties
| Compound Name | 2-methoxycyclohexa-2,4-diene-1-thione |
| PubChem CID | 21273364 |
| Molecular Formula | C7H8OS |
| Molecular Weight | 140.21 g/mol |
| Exact Mass | 140.03 |
| IUPAC Name | 2-methoxycyclohexa-2,4-diene-1-thione |
| SMILES | COC1=CC=CCC1=S |
| InChI | InChI=1S/C7H8OS/c1-8-6-4-2-3-5-7(6)9/h2-4H,5H2,1H3 |
| InChIKey | UWTJMYZJPHRZSZ-UHFFFAOYSA-N |
| XLogP | 1.85 |
| TPSA | 9.23 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 9 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 140.21 |
| LogP ≤ 5 | 1.85 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'thio_ketone(43)', 'substructure': 'N/A'}, {'alert_name': 'Thiocarbonyl_group', 'substructure': 'N/A'} |
|---|
Analyze 2-methoxycyclohexa-2,4-diene-1-thione with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 2-methoxycyclohexa-2,4-diene-1-thione?
The IUPAC name of 2-methoxycyclohexa-2,4-diene-1-thione (CID 21273364) is 2-methoxycyclohexa-2,4-diene-1-thione.
What is the SMILES notation for 2-methoxycyclohexa-2,4-diene-1-thione?
The canonical SMILES for 2-methoxycyclohexa-2,4-diene-1-thione is COC1=CC=CCC1=S.
What is the InChIKey of 2-methoxycyclohexa-2,4-diene-1-thione?
The InChIKey is UWTJMYZJPHRZSZ-UHFFFAOYSA-N. The full InChI is InChI=1S/C7H8OS/c1-8-6-4-2-3-5-7(6)9/h2-4H,5H2,1H3.
What are the key properties of 2-methoxycyclohexa-2,4-diene-1-thione?
2-methoxycyclohexa-2,4-diene-1-thione has a molecular weight of 140.21 g/mol, XLogP of 1.85, 1 rotatable bonds, 0 hydrogen bond donors, and 2 hydrogen bond acceptors.
Where does this data come from?
All data for 2-methoxycyclohexa-2,4-diene-1-thione is sourced from PubChem (CID 21273364), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).