About 3-ethylfluoranthene
3-ethylfluoranthene (PubChem CID 21273698) has the molecular formula C18H14
and a molecular weight of 230.31 g/mol. Its IUPAC name is 3-ethylfluoranthene.
Molecular Properties
| Compound Name | 3-ethylfluoranthene |
| PubChem CID | 21273698 |
| Molecular Formula | C18H14 |
| Molecular Weight | 230.31 g/mol |
| Exact Mass | 230.11 |
| IUPAC Name | 3-ethylfluoranthene |
| SMILES | CCc1ccc2c3c(cccc13)-c1ccccc1-2 |
| InChI | InChI=1S/C18H14/c1-2-12-10-11-17-15-7-4-3-6-14(15)16-9-5-8-13(12)18(16)17/h3-11H,2H2,1H3 |
| InChIKey | JXUOLJXLPIIRTP-UHFFFAOYSA-N |
| XLogP | 5.05 |
| TPSA | 0.00 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | |
| Rotatable Bonds | 1 |
| Heavy Atoms | 18 |
| Complexity | — |
Lipinski Rule of Five
1 violation
| Rule | Value |
| MW ≤ 500 | 230.31 |
| LogP ≤ 5 | 5.05 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 0 |
Analyze 3-ethylfluoranthene with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 3-ethylfluoranthene?
The IUPAC name of 3-ethylfluoranthene (CID 21273698) is 3-ethylfluoranthene.
What is the SMILES notation for 3-ethylfluoranthene?
The canonical SMILES for 3-ethylfluoranthene is CCc1ccc2c3c(cccc13)-c1ccccc1-2.
What is the InChIKey of 3-ethylfluoranthene?
The InChIKey is JXUOLJXLPIIRTP-UHFFFAOYSA-N. The full InChI is InChI=1S/C18H14/c1-2-12-10-11-17-15-7-4-3-6-14(15)16-9-5-8-13(12)18(16)17/h3-11H,2H2,1H3.
What are the key properties of 3-ethylfluoranthene?
3-ethylfluoranthene has a molecular weight of 230.31 g/mol, XLogP of 5.05, 1 rotatable bonds, 0 hydrogen bond donors, and 0 hydrogen bond acceptors.
Where does this data come from?
All data for 3-ethylfluoranthene is sourced from PubChem (CID 21273698), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).