About (2-amino-2-oxoethyl) 3-[[(E)-2-phenylethenyl]sulfonylamino]benzoate
(2-amino-2-oxoethyl) 3-[[(E)-2-phenylethenyl]sulfonylamino]benzoate (PubChem CID 2127405) has the molecular formula C17H16N2O5S
and a molecular weight of 360.39 g/mol. Its IUPAC name is (2-amino-2-oxoethyl) 3-[[(E)-2-phenylethenyl]sulfonylamino]benzoate.
Molecular Properties
| Compound Name | (2-amino-2-oxoethyl) 3-[[(E)-2-phenylethenyl]sulfonylamino]benzoate |
| PubChem CID | 2127405 |
| Molecular Formula | C17H16N2O5S |
| Molecular Weight | 360.39 g/mol |
| Exact Mass | 360.08 |
| IUPAC Name | (2-amino-2-oxoethyl) 3-[[(E)-2-phenylethenyl]sulfonylamino]benzoate |
| SMILES | NC(=O)COC(=O)c1cccc(NS(=O)(=O)/C=C/c2ccccc2)c1 |
| InChI | InChI=1S/C17H16N2O5S/c18-16(20)12-24-17(21)14-7-4-8-15(11-14)19-25(22,23)10-9-13-5-2-1-3-6-13/h1-11,19H,12H2,(H2,18,20)/b10-9+ |
| InChIKey | DRLDIUOETCLBKX-MDZDMXLPSA-N |
| XLogP | 1.74 |
| TPSA | 115.56 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 25 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 360.39 |
| LogP ≤ 5 | 1.74 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |
Analyze (2-amino-2-oxoethyl) 3-[[(E)-2-phenylethenyl]sulfonylamino]benzoate with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of (2-amino-2-oxoethyl) 3-[[(E)-2-phenylethenyl]sulfonylamino]benzoate?
The IUPAC name of (2-amino-2-oxoethyl) 3-[[(E)-2-phenylethenyl]sulfonylamino]benzoate (CID 2127405) is (2-amino-2-oxoethyl) 3-[[(E)-2-phenylethenyl]sulfonylamino]benzoate.
What is the SMILES notation for (2-amino-2-oxoethyl) 3-[[(E)-2-phenylethenyl]sulfonylamino]benzoate?
The canonical SMILES for (2-amino-2-oxoethyl) 3-[[(E)-2-phenylethenyl]sulfonylamino]benzoate is NC(=O)COC(=O)c1cccc(NS(=O)(=O)/C=C/c2ccccc2)c1.
What is the InChIKey of (2-amino-2-oxoethyl) 3-[[(E)-2-phenylethenyl]sulfonylamino]benzoate?
The InChIKey is DRLDIUOETCLBKX-MDZDMXLPSA-N. The full InChI is InChI=1S/C17H16N2O5S/c18-16(20)12-24-17(21)14-7-4-8-15(11-14)19-25(22,23)10-9-13-5-2-1-3-6-13/h1-11,19H,12H2,(H2,18,20)/b10-9+.
What are the key properties of (2-amino-2-oxoethyl) 3-[[(E)-2-phenylethenyl]sulfonylamino]benzoate?
(2-amino-2-oxoethyl) 3-[[(E)-2-phenylethenyl]sulfonylamino]benzoate has a molecular weight of 360.39 g/mol, XLogP of 1.74, 7 rotatable bonds, 2 hydrogen bond donors, and 5 hydrogen bond acceptors.
Where does this data come from?
All data for (2-amino-2-oxoethyl) 3-[[(E)-2-phenylethenyl]sulfonylamino]benzoate is sourced from PubChem (CID 2127405), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).