About 3H-inden-5-ol
3H-inden-5-ol (PubChem CID 21274580) has the molecular formula C9H8O
and a molecular weight of 132.16 g/mol. Its IUPAC name is 3H-inden-5-ol.
Molecular Properties
| Compound Name | 3H-inden-5-ol |
| PubChem CID | 21274580 |
| Molecular Formula | C9H8O |
| Molecular Weight | 132.16 g/mol |
| Exact Mass | 132.06 |
| IUPAC Name | 3H-inden-5-ol |
| SMILES | Oc1ccc2c(c1)CC=C2 |
| InChI | InChI=1S/C9H8O/c10-9-5-4-7-2-1-3-8(7)6-9/h1-2,4-6,10H,3H2 |
| InChIKey | PODHIIGQVAJGOK-UHFFFAOYSA-N |
| XLogP | 1.96 |
| TPSA | 20.23 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | |
| Heavy Atoms | 10 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 132.16 |
| LogP ≤ 5 | 1.96 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 1 |
Analyze 3H-inden-5-ol with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 3H-inden-5-ol?
The IUPAC name of 3H-inden-5-ol (CID 21274580) is 3H-inden-5-ol.
What is the SMILES notation for 3H-inden-5-ol?
The canonical SMILES for 3H-inden-5-ol is Oc1ccc2c(c1)CC=C2.
What is the InChIKey of 3H-inden-5-ol?
The InChIKey is PODHIIGQVAJGOK-UHFFFAOYSA-N. The full InChI is InChI=1S/C9H8O/c10-9-5-4-7-2-1-3-8(7)6-9/h1-2,4-6,10H,3H2.
What are the key properties of 3H-inden-5-ol?
3H-inden-5-ol has a molecular weight of 132.16 g/mol, XLogP of 1.96, 0 rotatable bonds, 1 hydrogen bond donors, and 1 hydrogen bond acceptors.
Where does this data come from?
All data for 3H-inden-5-ol is sourced from PubChem (CID 21274580), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).