About 3-nitrohexane
3-nitrohexane (PubChem CID 21274669) has the molecular formula C6H13NO2
and a molecular weight of 131.18 g/mol. Its IUPAC name is 3-nitrohexane.
Molecular Properties
| Compound Name | 3-nitrohexane |
| PubChem CID | 21274669 |
| Molecular Formula | C6H13NO2 |
| Molecular Weight | 131.18 g/mol |
| Exact Mass | 131.09 |
| IUPAC Name | 3-nitrohexane |
| SMILES | CCCC(CC)[N+](=O)[O-] |
| InChI | InChI=1S/C6H13NO2/c1-3-5-6(4-2)7(8)9/h6H,3-5H2,1-2H3 |
| InChIKey | IVZRMEMSOIPCGU-UHFFFAOYSA-N |
| XLogP | 1.84 |
| TPSA | 43.14 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 9 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 131.18 |
| LogP ≤ 5 | 1.84 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|
Analyze 3-nitrohexane with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 3-nitrohexane?
The IUPAC name of 3-nitrohexane (CID 21274669) is 3-nitrohexane.
What is the SMILES notation for 3-nitrohexane?
The canonical SMILES for 3-nitrohexane is CCCC(CC)[N+](=O)[O-].
What is the InChIKey of 3-nitrohexane?
The InChIKey is IVZRMEMSOIPCGU-UHFFFAOYSA-N. The full InChI is InChI=1S/C6H13NO2/c1-3-5-6(4-2)7(8)9/h6H,3-5H2,1-2H3.
What are the key properties of 3-nitrohexane?
3-nitrohexane has a molecular weight of 131.18 g/mol, XLogP of 1.84, 4 rotatable bonds, 0 hydrogen bond donors, and 2 hydrogen bond acceptors.
Where does this data come from?
All data for 3-nitrohexane is sourced from PubChem (CID 21274669), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).