About 2,5-dinitro-1H-imidazole
2,5-dinitro-1H-imidazole (PubChem CID 21275) has the molecular formula C3H2N4O4
and a molecular weight of 158.07 g/mol. Its IUPAC name is 2,5-dinitro-1H-imidazole.
Molecular Properties
| Compound Name | 2,5-dinitro-1H-imidazole |
| PubChem CID | 21275 |
| Molecular Formula | C3H2N4O4 |
| Molecular Weight | 158.07 g/mol |
| Exact Mass | 158.01 |
| IUPAC Name | 2,5-dinitro-1H-imidazole |
| SMILES | O=[N+]([O-])c1cnc([N+](=O)[O-])[nH]1 |
| InChI | InChI=1S/C3H2N4O4/c8-6(9)2-1-4-3(5-2)7(10)11/h1H,(H,4,5) |
| InChIKey | FLDSOXFRYVOGFK-UHFFFAOYSA-N |
| XLogP | 0.23 |
| TPSA | 114.96 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 11 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 158.07 |
| LogP ≤ 5 | 0.23 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|
Analyze 2,5-dinitro-1H-imidazole with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 2,5-dinitro-1H-imidazole?
The IUPAC name of 2,5-dinitro-1H-imidazole (CID 21275) is 2,5-dinitro-1H-imidazole.
What is the SMILES notation for 2,5-dinitro-1H-imidazole?
The canonical SMILES for 2,5-dinitro-1H-imidazole is O=[N+]([O-])c1cnc([N+](=O)[O-])[nH]1.
What is the InChIKey of 2,5-dinitro-1H-imidazole?
The InChIKey is FLDSOXFRYVOGFK-UHFFFAOYSA-N. The full InChI is InChI=1S/C3H2N4O4/c8-6(9)2-1-4-3(5-2)7(10)11/h1H,(H,4,5).
What are the key properties of 2,5-dinitro-1H-imidazole?
2,5-dinitro-1H-imidazole has a molecular weight of 158.07 g/mol, XLogP of 0.23, 2 rotatable bonds, 1 hydrogen bond donors, and 5 hydrogen bond acceptors.
Where does this data come from?
All data for 2,5-dinitro-1H-imidazole is sourced from PubChem (CID 21275), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).