About 1-phenyl-3-(5-phenyl-1,3,4-oxadiazol-2-yl)urea
1-phenyl-3-(5-phenyl-1,3,4-oxadiazol-2-yl)urea (PubChem CID 2127532) has the molecular formula C15H12N4O2
and a molecular weight of 280.29 g/mol. Its IUPAC name is 1-phenyl-3-(5-phenyl-1,3,4-oxadiazol-2-yl)urea.
Molecular Properties
| Compound Name | 1-phenyl-3-(5-phenyl-1,3,4-oxadiazol-2-yl)urea |
| PubChem CID | 2127532 |
| Molecular Formula | C15H12N4O2 |
| Molecular Weight | 280.29 g/mol |
| Exact Mass | 280.10 |
| IUPAC Name | 1-phenyl-3-(5-phenyl-1,3,4-oxadiazol-2-yl)urea |
| SMILES | O=C(Nc1ccccc1)Nc1nnc(-c2ccccc2)o1 |
| InChI | InChI=1S/C15H12N4O2/c20-14(16-12-9-5-2-6-10-12)17-15-19-18-13(21-15)11-7-3-1-4-8-11/h1-10H,(H2,16,17,19,20) |
| InChIKey | PSMQISOBUVOGMO-UHFFFAOYSA-N |
| XLogP | 3.38 |
| TPSA | 80.05 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 21 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 280.29 |
| LogP ≤ 5 | 3.38 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
Analyze 1-phenyl-3-(5-phenyl-1,3,4-oxadiazol-2-yl)urea with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 1-phenyl-3-(5-phenyl-1,3,4-oxadiazol-2-yl)urea?
The IUPAC name of 1-phenyl-3-(5-phenyl-1,3,4-oxadiazol-2-yl)urea (CID 2127532) is 1-phenyl-3-(5-phenyl-1,3,4-oxadiazol-2-yl)urea.
What is the SMILES notation for 1-phenyl-3-(5-phenyl-1,3,4-oxadiazol-2-yl)urea?
The canonical SMILES for 1-phenyl-3-(5-phenyl-1,3,4-oxadiazol-2-yl)urea is O=C(Nc1ccccc1)Nc1nnc(-c2ccccc2)o1.
What is the InChIKey of 1-phenyl-3-(5-phenyl-1,3,4-oxadiazol-2-yl)urea?
The InChIKey is PSMQISOBUVOGMO-UHFFFAOYSA-N. The full InChI is InChI=1S/C15H12N4O2/c20-14(16-12-9-5-2-6-10-12)17-15-19-18-13(21-15)11-7-3-1-4-8-11/h1-10H,(H2,16,17,19,20).
What are the key properties of 1-phenyl-3-(5-phenyl-1,3,4-oxadiazol-2-yl)urea?
1-phenyl-3-(5-phenyl-1,3,4-oxadiazol-2-yl)urea has a molecular weight of 280.29 g/mol, XLogP of 3.38, 3 rotatable bonds, 2 hydrogen bond donors, and 4 hydrogen bond acceptors.
Where does this data come from?
All data for 1-phenyl-3-(5-phenyl-1,3,4-oxadiazol-2-yl)urea is sourced from PubChem (CID 2127532), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).