About N-[2-(benzylamino)ethyl]-4-imidazol-1-ylbenzamide;hydrochloride
N-[2-(benzylamino)ethyl]-4-imidazol-1-ylbenzamide;hydrochloride (PubChem CID 21275374) has the molecular formula C19H21ClN4O
and a molecular weight of 356.86 g/mol. Its IUPAC name is N-[2-(benzylamino)ethyl]-4-imidazol-1-ylbenzamide;hydrochloride.
Molecular Properties
| Compound Name | N-[2-(benzylamino)ethyl]-4-imidazol-1-ylbenzamide;hydrochloride |
| PubChem CID | 21275374 |
| Molecular Formula | C19H21ClN4O |
| Molecular Weight | 356.86 g/mol |
| Exact Mass | 356.14 |
| IUPAC Name | N-[2-(benzylamino)ethyl]-4-imidazol-1-ylbenzamide;hydrochloride |
| SMILES | Cl.O=C(NCCNCc1ccccc1)c1ccc(-n2ccnc2)cc1 |
| InChI | InChI=1S/C19H20N4O.ClH/c24-19(22-11-10-20-14-16-4-2-1-3-5-16)17-6-8-18(9-7-17)23-13-12-21-15-23;/h1-9,12-13,15,20H,10-11,14H2,(H,22,24);1H |
| InChIKey | HDGGNCNUGBHUQD-UHFFFAOYSA-N |
| XLogP | 2.81 |
| TPSA | 58.95 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 25 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 356.86 |
| LogP ≤ 5 | 2.81 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|
Analyze N-[2-(benzylamino)ethyl]-4-imidazol-1-ylbenzamide;hydrochloride with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of N-[2-(benzylamino)ethyl]-4-imidazol-1-ylbenzamide;hydrochloride?
The IUPAC name of N-[2-(benzylamino)ethyl]-4-imidazol-1-ylbenzamide;hydrochloride (CID 21275374) is N-[2-(benzylamino)ethyl]-4-imidazol-1-ylbenzamide;hydrochloride.
What is the SMILES notation for N-[2-(benzylamino)ethyl]-4-imidazol-1-ylbenzamide;hydrochloride?
The canonical SMILES for N-[2-(benzylamino)ethyl]-4-imidazol-1-ylbenzamide;hydrochloride is Cl.O=C(NCCNCc1ccccc1)c1ccc(-n2ccnc2)cc1.
What is the InChIKey of N-[2-(benzylamino)ethyl]-4-imidazol-1-ylbenzamide;hydrochloride?
The InChIKey is HDGGNCNUGBHUQD-UHFFFAOYSA-N. The full InChI is InChI=1S/C19H20N4O.ClH/c24-19(22-11-10-20-14-16-4-2-1-3-5-16)17-6-8-18(9-7-17)23-13-12-21-15-23;/h1-9,12-13,15,20H,10-11,14H2,(H,22,24);1H.
What are the key properties of N-[2-(benzylamino)ethyl]-4-imidazol-1-ylbenzamide;hydrochloride?
N-[2-(benzylamino)ethyl]-4-imidazol-1-ylbenzamide;hydrochloride has a molecular weight of 356.86 g/mol, XLogP of 2.81, 7 rotatable bonds, 2 hydrogen bond donors, and 4 hydrogen bond acceptors.
Where does this data come from?
All data for N-[2-(benzylamino)ethyl]-4-imidazol-1-ylbenzamide;hydrochloride is sourced from PubChem (CID 21275374), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).