C19H35ClO5 — CID 21275773
1-chloro-5-(5,5-dimethyl-1,3-dioxan-2-yl)pentan-2-ol;2-ethenyl-5,5-dimethyl-1,3-dioxane (PubChem CID 21275773) has the molecular formula C19H35ClO5 and a molecular weight of 378.94 g/mol. Its IUPAC name is 1-chloro-5-(5,5-dimethyl-1,3-dioxan-2-yl)pentan-2-ol;2-ethenyl-5,5-dimethyl-1,3-dioxane.
| Compound Name | 1-chloro-5-(5,5-dimethyl-1,3-dioxan-2-yl)pentan-2-ol;2-ethenyl-5,5-dimethyl-1,3-dioxane |
|---|---|
| PubChem CID | 21275773 |
| Molecular Formula | C19H35ClO5 |
| Molecular Weight | 378.94 g/mol |
| Exact Mass | 378.22 |
| IUPAC Name | 1-chloro-5-(5,5-dimethyl-1,3-dioxan-2-yl)pentan-2-ol;2-ethenyl-5,5-dimethyl-1,3-dioxane |
| SMILES | C=CC1OCC(C)(C)CO1.CC1(C)COC(CCCC(O)CCl)OC1 |
| InChI | InChI=1S/C11H21ClO3.C8H14O2/c1-11(2)7-14-10(15-8-11)5-3-4-9(13)6-12;1-4-7-9-5-8(2,3)6-10-7/h9-10,13H,3-8H2,1-2H3;4,7H,1,5-6H2,2-3H3 |
| InChIKey | MRWUMJFZJOOKDQ-UHFFFAOYSA-N |
| XLogP | 3.73 |
| TPSA | 57.15 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 378.94 |
| LogP ≤ 5 | 3.73 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'alkyl_halide', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|