C21H16F4N2O3S — CID 2127586
(4-naphthalen-2-ylsulfonylpiperazin-1-yl)-(2,3,4,5-tetrafluorophenyl)methanone (PubChem CID 2127586) has the molecular formula C21H16F4N2O3S and a molecular weight of 452.43 g/mol. Its IUPAC name is (4-naphthalen-2-ylsulfonylpiperazin-1-yl)-(2,3,4,5-tetrafluorophenyl)methanone.
| Compound Name | (4-naphthalen-2-ylsulfonylpiperazin-1-yl)-(2,3,4,5-tetrafluorophenyl)methanone |
|---|---|
| PubChem CID | 2127586 |
| Molecular Formula | C21H16F4N2O3S |
| Molecular Weight | 452.43 g/mol |
| Exact Mass | 452.08 |
| IUPAC Name | (4-naphthalen-2-ylsulfonylpiperazin-1-yl)-(2,3,4,5-tetrafluorophenyl)methanone |
| SMILES | O=C(c1cc(F)c(F)c(F)c1F)N1CCN(S(=O)(=O)c2ccc3ccccc3c2)CC1 |
| InChI | InChI=1S/C21H16F4N2O3S/c22-17-12-16(18(23)20(25)19(17)24)21(28)26-7-9-27(10-8-26)31(29,30)15-6-5-13-3-1-2-4-14(13)11-15/h1-6,11-12H,7-10H2 |
| InChIKey | SKRHVTSESHPJOY-UHFFFAOYSA-N |
| XLogP | 3.54 |
| TPSA | 57.69 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 31 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 452.43 |
| LogP ≤ 5 | 3.54 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'halogenated_ring_1', 'substructure': 'N/A'}, {'alert_name': 'halogenated_ring_2', 'substructure': 'N/A'} |
|---|