About acridine;acridine-3,6-diamine
acridine;acridine-3,6-diamine (PubChem CID 21276006) has the molecular formula C26H20N4
and a molecular weight of 388.47 g/mol. Its IUPAC name is acridine;acridine-3,6-diamine.
Molecular Properties
| Compound Name | acridine;acridine-3,6-diamine |
| PubChem CID | 21276006 |
| Molecular Formula | C26H20N4 |
| Molecular Weight | 388.47 g/mol |
| Exact Mass | 388.17 |
| IUPAC Name | acridine;acridine-3,6-diamine |
| SMILES | Nc1ccc2cc3ccc(N)cc3nc2c1.c1ccc2nc3ccccc3cc2c1 |
| InChI | InChI=1S/C13H11N3.C13H9N/c14-10-3-1-8-5-9-2-4-11(15)7-13(9)16-12(8)6-10;1-3-7-12-10(5-1)9-11-6-2-4-8-13(11)14-12/h1-7H,14-15H2;1-9H |
| InChIKey | BRFIIPIEUOOOLJ-UHFFFAOYSA-N |
| XLogP | 5.94 |
| TPSA | 77.82 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | |
| Heavy Atoms | 30 |
| Complexity | — |
Lipinski Rule of Five
1 violation
| Rule | Value |
| MW ≤ 500 | 388.47 |
| LogP ≤ 5 | 5.94 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'aniline', 'substructure': 'N/A'}, {'alert_name': 'Polycyclic_aromatic_hydrocarbon_2', 'substructure': 'N/A'} |
|---|
Analyze acridine;acridine-3,6-diamine with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of acridine;acridine-3,6-diamine?
The IUPAC name of acridine;acridine-3,6-diamine (CID 21276006) is acridine;acridine-3,6-diamine.
What is the SMILES notation for acridine;acridine-3,6-diamine?
The canonical SMILES for acridine;acridine-3,6-diamine is Nc1ccc2cc3ccc(N)cc3nc2c1.c1ccc2nc3ccccc3cc2c1.
What is the InChIKey of acridine;acridine-3,6-diamine?
The InChIKey is BRFIIPIEUOOOLJ-UHFFFAOYSA-N. The full InChI is InChI=1S/C13H11N3.C13H9N/c14-10-3-1-8-5-9-2-4-11(15)7-13(9)16-12(8)6-10;1-3-7-12-10(5-1)9-11-6-2-4-8-13(11)14-12/h1-7H,14-15H2;1-9H.
What are the key properties of acridine;acridine-3,6-diamine?
acridine;acridine-3,6-diamine has a molecular weight of 388.47 g/mol, XLogP of 5.94, 0 rotatable bonds, 2 hydrogen bond donors, and 4 hydrogen bond acceptors.
Where does this data come from?
All data for acridine;acridine-3,6-diamine is sourced from PubChem (CID 21276006), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).