About 6-(methoxymethyl)-1,4-dioxa-7-thiaspiro[4.4]nonane
6-(methoxymethyl)-1,4-dioxa-7-thiaspiro[4.4]nonane (PubChem CID 21276496) has the molecular formula C8H14O3S
and a molecular weight of 190.26 g/mol. Its IUPAC name is 6-(methoxymethyl)-1,4-dioxa-7-thiaspiro[4.4]nonane.
Molecular Properties
| Compound Name | 6-(methoxymethyl)-1,4-dioxa-7-thiaspiro[4.4]nonane |
| PubChem CID | 21276496 |
| Molecular Formula | C8H14O3S |
| Molecular Weight | 190.26 g/mol |
| Exact Mass | 190.07 |
| IUPAC Name | 6-(methoxymethyl)-1,4-dioxa-7-thiaspiro[4.4]nonane |
| SMILES | COCC1SCCC12OCCO2 |
| InChI | InChI=1S/C8H14O3S/c1-9-6-7-8(2-5-12-7)10-3-4-11-8/h7H,2-6H2,1H3 |
| InChIKey | WIJWKVLCDSYBBE-UHFFFAOYSA-N |
| XLogP | 0.88 |
| TPSA | 27.69 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 12 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 190.26 |
| LogP ≤ 5 | 0.88 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
Analyze 6-(methoxymethyl)-1,4-dioxa-7-thiaspiro[4.4]nonane with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 6-(methoxymethyl)-1,4-dioxa-7-thiaspiro[4.4]nonane?
The IUPAC name of 6-(methoxymethyl)-1,4-dioxa-7-thiaspiro[4.4]nonane (CID 21276496) is 6-(methoxymethyl)-1,4-dioxa-7-thiaspiro[4.4]nonane.
What is the SMILES notation for 6-(methoxymethyl)-1,4-dioxa-7-thiaspiro[4.4]nonane?
The canonical SMILES for 6-(methoxymethyl)-1,4-dioxa-7-thiaspiro[4.4]nonane is COCC1SCCC12OCCO2.
What is the InChIKey of 6-(methoxymethyl)-1,4-dioxa-7-thiaspiro[4.4]nonane?
The InChIKey is WIJWKVLCDSYBBE-UHFFFAOYSA-N. The full InChI is InChI=1S/C8H14O3S/c1-9-6-7-8(2-5-12-7)10-3-4-11-8/h7H,2-6H2,1H3.
What are the key properties of 6-(methoxymethyl)-1,4-dioxa-7-thiaspiro[4.4]nonane?
6-(methoxymethyl)-1,4-dioxa-7-thiaspiro[4.4]nonane has a molecular weight of 190.26 g/mol, XLogP of 0.88, 2 rotatable bonds, 0 hydrogen bond donors, and 4 hydrogen bond acceptors.
Where does this data come from?
All data for 6-(methoxymethyl)-1,4-dioxa-7-thiaspiro[4.4]nonane is sourced from PubChem (CID 21276496), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).