C18H16N2O2 — CID 21276671
2,2-dimethyl-5-phenyl-3H-furo[3,2-c][1,8]naphthyridin-4-one (PubChem CID 21276671) has the molecular formula C18H16N2O2 and a molecular weight of 292.34 g/mol. Its IUPAC name is 2,2-dimethyl-5-phenyl-3H-furo[3,2-c][1,8]naphthyridin-4-one.
| Compound Name | 2,2-dimethyl-5-phenyl-3H-furo[3,2-c][1,8]naphthyridin-4-one |
|---|---|
| PubChem CID | 21276671 |
| Molecular Formula | C18H16N2O2 |
| Molecular Weight | 292.34 g/mol |
| Exact Mass | 292.12 |
| IUPAC Name | 2,2-dimethyl-5-phenyl-3H-furo[3,2-c][1,8]naphthyridin-4-one |
| SMILES | CC1(C)Cc2c(c3cccnc3n(-c3ccccc3)c2=O)O1 |
| InChI | InChI=1S/C18H16N2O2/c1-18(2)11-14-15(22-18)13-9-6-10-19-16(13)20(17(14)21)12-7-4-3-5-8-12/h3-10H,11H2,1-2H3 |
| InChIKey | ROPONZRFLDPLAR-UHFFFAOYSA-N |
| XLogP | 3.10 |
| TPSA | 44.12 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 22 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 292.34 |
| LogP ≤ 5 | 3.10 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |