C12H10N4O — CID 21276739
3-oxo-1,2,4,5-tetrahydropyrido[4,3-c][1,8]naphthyridine-6-carbonitrile (PubChem CID 21276739) has the molecular formula C12H10N4O and a molecular weight of 226.24 g/mol. Its IUPAC name is 3-oxo-1,2,4,5-tetrahydropyrido[4,3-c][1,8]naphthyridine-6-carbonitrile.
| Compound Name | 3-oxo-1,2,4,5-tetrahydropyrido[4,3-c][1,8]naphthyridine-6-carbonitrile |
|---|---|
| PubChem CID | 21276739 |
| Molecular Formula | C12H10N4O |
| Molecular Weight | 226.24 g/mol |
| Exact Mass | 226.09 |
| IUPAC Name | 3-oxo-1,2,4,5-tetrahydropyrido[4,3-c][1,8]naphthyridine-6-carbonitrile |
| SMILES | N#CN1CC2=C(CNC(=O)C2)c2cccnc21 |
| InChI | InChI=1S/C12H10N4O/c13-7-16-6-8-4-11(17)15-5-10(8)9-2-1-3-14-12(9)16/h1-3H,4-6H2,(H,15,17) |
| InChIKey | VHORGXCOXZLYDK-UHFFFAOYSA-N |
| XLogP | 0.66 |
| TPSA | 69.02 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | |
| Heavy Atoms | 17 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 226.24 |
| LogP ≤ 5 | 0.66 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'cyanate_/aminonitrile_/thiocyanate', 'substructure': 'N/A'} |
|---|