About [4-(4-oxo-2,3-dihydrochromen-2-yl)phenyl] thiohypochlorite
[4-(4-oxo-2,3-dihydrochromen-2-yl)phenyl] thiohypochlorite (PubChem CID 21276850) has the molecular formula C15H11ClO2S
and a molecular weight of 290.77 g/mol. Its IUPAC name is [4-(4-oxo-2,3-dihydrochromen-2-yl)phenyl] thiohypochlorite.
Molecular Properties
| Compound Name | [4-(4-oxo-2,3-dihydrochromen-2-yl)phenyl] thiohypochlorite |
| PubChem CID | 21276850 |
| Molecular Formula | C15H11ClO2S |
| Molecular Weight | 290.77 g/mol |
| Exact Mass | 290.02 |
| IUPAC Name | [4-(4-oxo-2,3-dihydrochromen-2-yl)phenyl] thiohypochlorite |
| SMILES | O=C1CC(c2ccc(SCl)cc2)Oc2ccccc21 |
| InChI | InChI=1S/C15H11ClO2S/c16-19-11-7-5-10(6-8-11)15-9-13(17)12-3-1-2-4-14(12)18-15/h1-8,15H,9H2 |
| InChIKey | RXYNIQLQWAEHAS-UHFFFAOYSA-N |
| XLogP | 4.64 |
| TPSA | 26.30 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 19 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 290.77 |
| LogP ≤ 5 | 4.64 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
Analyze [4-(4-oxo-2,3-dihydrochromen-2-yl)phenyl] thiohypochlorite with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of [4-(4-oxo-2,3-dihydrochromen-2-yl)phenyl] thiohypochlorite?
The IUPAC name of [4-(4-oxo-2,3-dihydrochromen-2-yl)phenyl] thiohypochlorite (CID 21276850) is [4-(4-oxo-2,3-dihydrochromen-2-yl)phenyl] thiohypochlorite.
What is the SMILES notation for [4-(4-oxo-2,3-dihydrochromen-2-yl)phenyl] thiohypochlorite?
The canonical SMILES for [4-(4-oxo-2,3-dihydrochromen-2-yl)phenyl] thiohypochlorite is O=C1CC(c2ccc(SCl)cc2)Oc2ccccc21.
What is the InChIKey of [4-(4-oxo-2,3-dihydrochromen-2-yl)phenyl] thiohypochlorite?
The InChIKey is RXYNIQLQWAEHAS-UHFFFAOYSA-N. The full InChI is InChI=1S/C15H11ClO2S/c16-19-11-7-5-10(6-8-11)15-9-13(17)12-3-1-2-4-14(12)18-15/h1-8,15H,9H2.
What are the key properties of [4-(4-oxo-2,3-dihydrochromen-2-yl)phenyl] thiohypochlorite?
[4-(4-oxo-2,3-dihydrochromen-2-yl)phenyl] thiohypochlorite has a molecular weight of 290.77 g/mol, XLogP of 4.64, 2 rotatable bonds, 0 hydrogen bond donors, and 3 hydrogen bond acceptors.
Where does this data come from?
All data for [4-(4-oxo-2,3-dihydrochromen-2-yl)phenyl] thiohypochlorite is sourced from PubChem (CID 21276850), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).