C14H13Cl8O13P — CID 21276942
[2,3,4-tris[(2,2-dichloroacetyl)oxy]-6-hydroxy-5-phosphonooxycyclohexyl] 2,2-dichloroacetate (PubChem CID 21276942) has the molecular formula C14H13Cl8O13P and a molecular weight of 703.84 g/mol. Its IUPAC name is [2,3,4-tris[(2,2-dichloroacetyl)oxy]-6-hydroxy-5-phosphonooxycyclohexyl] 2,2-dichloroacetate.
| Compound Name | [2,3,4-tris[(2,2-dichloroacetyl)oxy]-6-hydroxy-5-phosphonooxycyclohexyl] 2,2-dichloroacetate |
|---|---|
| PubChem CID | 21276942 |
| Molecular Formula | C14H13Cl8O13P |
| Molecular Weight | 703.84 g/mol |
| Exact Mass | 699.76 |
| IUPAC Name | [2,3,4-tris[(2,2-dichloroacetyl)oxy]-6-hydroxy-5-phosphonooxycyclohexyl] 2,2-dichloroacetate |
| SMILES | O=C(OC1C(O)C(OP(=O)(O)O)C(OC(=O)C(Cl)Cl)C(OC(=O)C(Cl)Cl)C1OC(=O)C(Cl)Cl)C(Cl)Cl |
| InChI | InChI=1S/C14H13Cl8O13P/c15-7(16)11(24)31-2-1(23)3(35-36(28,29)30)5(33-13(26)9(19)20)6(34-14(27)10(21)22)4(2)32-12(25)8(17)18/h1-10,23H,(H2,28,29,30) |
| InChIKey | DSPTXIQXGDXPCN-UHFFFAOYSA-N |
| XLogP | 1.70 |
| TPSA | 192.19 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 11 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 36 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 703.84 |
| LogP ≤ 5 | 1.70 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 11 |
| Structural Alerts | {'alert_name': '>_2_ester_groups', 'substructure': 'N/A'}, {'alert_name': 'alkyl_halide', 'substructure': 'N/A'}, {'alert_name': 'phosphor', 'substructure': 'N/A'} |
|---|