C6H11N3O2 — CID 21276969
1-butyl-1,2,4-triazolidine-3,5-dione (PubChem CID 21276969) has the molecular formula C6H11N3O2 and a molecular weight of 157.17 g/mol. Its IUPAC name is 1-butyl-1,2,4-triazolidine-3,5-dione.
| Compound Name | 1-butyl-1,2,4-triazolidine-3,5-dione |
|---|---|
| PubChem CID | 21276969 |
| Molecular Formula | C6H11N3O2 |
| Molecular Weight | 157.17 g/mol |
| Exact Mass | 157.09 |
| IUPAC Name | 1-butyl-1,2,4-triazolidine-3,5-dione |
| SMILES | CCCCn1[nH]c(=O)[nH]c1=O |
| InChI | InChI=1S/C6H11N3O2/c1-2-3-4-9-6(11)7-5(10)8-9/h2-4H2,1H3,(H2,7,8,10,11) |
| InChIKey | KJJOVLWUCDPOLX-UHFFFAOYSA-N |
| XLogP | -0.34 |
| TPSA | 70.65 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 11 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 157.17 |
| LogP ≤ 5 | -0.34 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |