C11H12FN5O — CID 21277252
6-(2-fluorophenyl)-3,4-bis(methylamino)-1,2,4-triazin-5-one (PubChem CID 21277252) has the molecular formula C11H12FN5O and a molecular weight of 249.25 g/mol. Its IUPAC name is 6-(2-fluorophenyl)-3,4-bis(methylamino)-1,2,4-triazin-5-one.
| Compound Name | 6-(2-fluorophenyl)-3,4-bis(methylamino)-1,2,4-triazin-5-one |
|---|---|
| PubChem CID | 21277252 |
| Molecular Formula | C11H12FN5O |
| Molecular Weight | 249.25 g/mol |
| Exact Mass | 249.10 |
| IUPAC Name | 6-(2-fluorophenyl)-3,4-bis(methylamino)-1,2,4-triazin-5-one |
| SMILES | CNc1nnc(-c2ccccc2F)c(=O)n1NC |
| InChI | InChI=1S/C11H12FN5O/c1-13-11-16-15-9(10(18)17(11)14-2)7-5-3-4-6-8(7)12/h3-6,14H,1-2H3,(H,13,16) |
| InChIKey | GWOLKJWCZBJQIX-UHFFFAOYSA-N |
| XLogP | 0.66 |
| TPSA | 71.84 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 18 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 249.25 |
| LogP ≤ 5 | 0.66 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 6 |