About 6-tert-butyl-4-(dimethylamino)-3-methylsulfanyl-1,2,4-triazin-5-one
6-tert-butyl-4-(dimethylamino)-3-methylsulfanyl-1,2,4-triazin-5-one (PubChem CID 21277254) has the molecular formula C10H18N4OS
and a molecular weight of 242.35 g/mol. Its IUPAC name is 6-tert-butyl-4-(dimethylamino)-3-methylsulfanyl-1,2,4-triazin-5-one.
Molecular Properties
| Compound Name | 6-tert-butyl-4-(dimethylamino)-3-methylsulfanyl-1,2,4-triazin-5-one |
| PubChem CID | 21277254 |
| Molecular Formula | C10H18N4OS |
| Molecular Weight | 242.35 g/mol |
| Exact Mass | 242.12 |
| IUPAC Name | 6-tert-butyl-4-(dimethylamino)-3-methylsulfanyl-1,2,4-triazin-5-one |
| SMILES | CSc1nnc(C(C)(C)C)c(=O)n1N(C)C |
| InChI | InChI=1S/C10H18N4OS/c1-10(2,3)7-8(15)14(13(4)5)9(16-6)12-11-7/h1-6H3 |
| InChIKey | QKRHGIHZZUMUFJ-UHFFFAOYSA-N |
| XLogP | 0.86 |
| TPSA | 51.02 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 16 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 242.35 |
| LogP ≤ 5 | 0.86 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 6 |
Analyze 6-tert-butyl-4-(dimethylamino)-3-methylsulfanyl-1,2,4-triazin-5-one with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 6-tert-butyl-4-(dimethylamino)-3-methylsulfanyl-1,2,4-triazin-5-one?
The IUPAC name of 6-tert-butyl-4-(dimethylamino)-3-methylsulfanyl-1,2,4-triazin-5-one (CID 21277254) is 6-tert-butyl-4-(dimethylamino)-3-methylsulfanyl-1,2,4-triazin-5-one.
What is the SMILES notation for 6-tert-butyl-4-(dimethylamino)-3-methylsulfanyl-1,2,4-triazin-5-one?
The canonical SMILES for 6-tert-butyl-4-(dimethylamino)-3-methylsulfanyl-1,2,4-triazin-5-one is CSc1nnc(C(C)(C)C)c(=O)n1N(C)C.
What is the InChIKey of 6-tert-butyl-4-(dimethylamino)-3-methylsulfanyl-1,2,4-triazin-5-one?
The InChIKey is QKRHGIHZZUMUFJ-UHFFFAOYSA-N. The full InChI is InChI=1S/C10H18N4OS/c1-10(2,3)7-8(15)14(13(4)5)9(16-6)12-11-7/h1-6H3.
What are the key properties of 6-tert-butyl-4-(dimethylamino)-3-methylsulfanyl-1,2,4-triazin-5-one?
6-tert-butyl-4-(dimethylamino)-3-methylsulfanyl-1,2,4-triazin-5-one has a molecular weight of 242.35 g/mol, XLogP of 0.86, 2 rotatable bonds, 0 hydrogen bond donors, and 6 hydrogen bond acceptors.
Where does this data come from?
All data for 6-tert-butyl-4-(dimethylamino)-3-methylsulfanyl-1,2,4-triazin-5-one is sourced from PubChem (CID 21277254), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).