C38H76N4O5P2 — CID 21277935
N-butyl-N-[5-[[2-[butyl-(2,2,6,6-tetramethylpiperidin-4-yl)amino]-5-ethyl-1,3,2-dioxaphosphinan-5-yl]methoxymethyl]-5-ethyl-1,3,2-dioxaphosphinan-2-yl]-2,2,6,6-tetramethylpiperidin-4-amine (PubChem CID 21277935) has the molecular formula C38H76N4O5P2 and a molecular weight of 731.00 g/mol. Its IUPAC name is N-butyl-N-[5-[[2-[butyl-(2,2,6,6-tetramethylpiperidin-4-yl)amino]-5-ethyl-1,3,2-dioxaphosphinan-5-yl]methoxymethyl]-5-ethyl-1,3,2-dioxaphosphinan-2-yl]-2,2,6,6-tetramethylpiperidin-4-amine.
| Compound Name | N-butyl-N-[5-[[2-[butyl-(2,2,6,6-tetramethylpiperidin-4-yl)amino]-5-ethyl-1,3,2-dioxaphosphinan-5-yl]methoxymethyl]-5-ethyl-1,3,2-dioxaphosphinan-2-yl]-2,2,6,6-tetramethylpiperidin-4-amine |
|---|---|
| PubChem CID | 21277935 |
| Molecular Formula | C38H76N4O5P2 |
| Molecular Weight | 731.00 g/mol |
| Exact Mass | 730.53 |
| IUPAC Name | N-butyl-N-[5-[[2-[butyl-(2,2,6,6-tetramethylpiperidin-4-yl)amino]-5-ethyl-1,3,2-dioxaphosphinan-5-yl]methoxymethyl]-5-ethyl-1,3,2-dioxaphosphinan-2-yl]-2,2,6,6-tetramethylpiperidin-4-amine |
| SMILES | CCCCN(C1CC(C)(C)NC(C)(C)C1)P1OCC(CC)(COCC2(CC)COP(N(CCCC)C3CC(C)(C)NC(C)(C)C3)OC2)CO1 |
| InChI | InChI=1S/C38H76N4O5P2/c1-13-17-19-41(31-21-33(5,6)39-34(7,8)22-31)48-44-27-37(15-3,28-45-48)25-43-26-38(16-4)29-46-49(47-30-38)42(20-18-14-2)32-23-35(9,10)40-36(11,12)24-32/h31-32,39-40H,13-30H2,1-12H3 |
| InChIKey | MUEVGEVAQSPUID-UHFFFAOYSA-N |
| XLogP | 9.17 |
| TPSA | 76.69 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 9 |
| Rotatable Bonds | 16 |
| Heavy Atoms | 49 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 731.00 |
| LogP ≤ 5 | 9.17 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 9 |
| Structural Alerts | {'alert_name': 'phosphor', 'substructure': 'N/A'} |
|---|