C29H58N4O4P2 — CID 21277937
3-N,9-N-dipropyl-3-N,9-N-bis(2,2,6,6-tetramethylpiperidin-4-yl)-2,4,8,10-tetraoxa-3,9-diphosphaspiro[5.5]undecane-3,9-diamine (PubChem CID 21277937) has the molecular formula C29H58N4O4P2 and a molecular weight of 588.76 g/mol. Its IUPAC name is 3-N,9-N-dipropyl-3-N,9-N-bis(2,2,6,6-tetramethylpiperidin-4-yl)-2,4,8,10-tetraoxa-3,9-diphosphaspiro[5.5]undecane-3,9-diamine.
| Compound Name | 3-N,9-N-dipropyl-3-N,9-N-bis(2,2,6,6-tetramethylpiperidin-4-yl)-2,4,8,10-tetraoxa-3,9-diphosphaspiro[5.5]undecane-3,9-diamine |
|---|---|
| PubChem CID | 21277937 |
| Molecular Formula | C29H58N4O4P2 |
| Molecular Weight | 588.76 g/mol |
| Exact Mass | 588.39 |
| IUPAC Name | 3-N,9-N-dipropyl-3-N,9-N-bis(2,2,6,6-tetramethylpiperidin-4-yl)-2,4,8,10-tetraoxa-3,9-diphosphaspiro[5.5]undecane-3,9-diamine |
| SMILES | CCCN(C1CC(C)(C)NC(C)(C)C1)P1OCC2(CO1)COP(N(CCC)C1CC(C)(C)NC(C)(C)C1)OC2 |
| InChI | InChI=1S/C29H58N4O4P2/c1-11-13-32(23-15-25(3,4)30-26(5,6)16-23)38-34-19-29(20-35-38)21-36-39(37-22-29)33(14-12-2)24-17-27(7,8)31-28(9,10)18-24/h23-24,30-31H,11-22H2,1-10H3 |
| InChIKey | AUVUMLPILJISCG-UHFFFAOYSA-N |
| XLogP | 6.56 |
| TPSA | 67.46 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 39 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 588.76 |
| LogP ≤ 5 | 6.56 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'phosphor', 'substructure': 'N/A'} |
|---|