C33H68N6O4P2 — CID 21277939
3-N,9-N-bis[2-(dimethylamino)ethyl]-3-N,9-N-bis(1,2,2,6,6-pentamethylpiperidin-4-yl)-2,4,8,10-tetraoxa-3,9-diphosphaspiro[5.5]undecane-3,9-diamine (PubChem CID 21277939) has the molecular formula C33H68N6O4P2 and a molecular weight of 674.89 g/mol. Its IUPAC name is 3-N,9-N-bis[2-(dimethylamino)ethyl]-3-N,9-N-bis(1,2,2,6,6-pentamethylpiperidin-4-yl)-2,4,8,10-tetraoxa-3,9-diphosphaspiro[5.5]undecane-3,9-diamine.
| Compound Name | 3-N,9-N-bis[2-(dimethylamino)ethyl]-3-N,9-N-bis(1,2,2,6,6-pentamethylpiperidin-4-yl)-2,4,8,10-tetraoxa-3,9-diphosphaspiro[5.5]undecane-3,9-diamine |
|---|---|
| PubChem CID | 21277939 |
| Molecular Formula | C33H68N6O4P2 |
| Molecular Weight | 674.89 g/mol |
| Exact Mass | 674.48 |
| IUPAC Name | 3-N,9-N-bis[2-(dimethylamino)ethyl]-3-N,9-N-bis(1,2,2,6,6-pentamethylpiperidin-4-yl)-2,4,8,10-tetraoxa-3,9-diphosphaspiro[5.5]undecane-3,9-diamine |
| SMILES | CN(C)CCN(C1CC(C)(C)N(C)C(C)(C)C1)P1OCC2(CO1)COP(N(CCN(C)C)C1CC(C)(C)N(C)C(C)(C)C1)OC2 |
| InChI | InChI=1S/C33H68N6O4P2/c1-29(2)19-27(20-30(3,4)36(29)13)38(17-15-34(9)10)44-40-23-33(24-41-44)25-42-45(43-26-33)39(18-16-35(11)12)28-21-31(5,6)37(14)32(7,8)22-28/h27-28H,15-26H2,1-14H3 |
| InChIKey | PKAYNDNPIJUEHB-UHFFFAOYSA-N |
| XLogP | 5.55 |
| TPSA | 56.36 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 10 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 45 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 674.89 |
| LogP ≤ 5 | 5.55 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 10 |
| Structural Alerts | {'alert_name': 'phosphor', 'substructure': 'N/A'} |
|---|