C34H68N4O4P2 — CID 21277958
N,N'-bis(5,5-dimethyl-1,3,2-dioxaphosphinan-2-yl)-N,N'-bis(2,2,6,6-tetramethylpiperidin-4-yl)hexane-1,6-diamine (PubChem CID 21277958) has the molecular formula C34H68N4O4P2 and a molecular weight of 658.89 g/mol. Its IUPAC name is N,N'-bis(5,5-dimethyl-1,3,2-dioxaphosphinan-2-yl)-N,N'-bis(2,2,6,6-tetramethylpiperidin-4-yl)hexane-1,6-diamine.
| Compound Name | N,N'-bis(5,5-dimethyl-1,3,2-dioxaphosphinan-2-yl)-N,N'-bis(2,2,6,6-tetramethylpiperidin-4-yl)hexane-1,6-diamine |
|---|---|
| PubChem CID | 21277958 |
| Molecular Formula | C34H68N4O4P2 |
| Molecular Weight | 658.89 g/mol |
| Exact Mass | 658.47 |
| IUPAC Name | N,N'-bis(5,5-dimethyl-1,3,2-dioxaphosphinan-2-yl)-N,N'-bis(2,2,6,6-tetramethylpiperidin-4-yl)hexane-1,6-diamine |
| SMILES | CC1(C)COP(N(CCCCCCN(C2CC(C)(C)NC(C)(C)C2)P2OCC(C)(C)CO2)C2CC(C)(C)NC(C)(C)C2)OC1 |
| InChI | InChI=1S/C34H68N4O4P2/c1-29(2)23-39-43(40-24-29)37(27-19-31(5,6)35-32(7,8)20-27)17-15-13-14-16-18-38(44-41-25-30(3,4)26-42-44)28-21-33(9,10)36-34(11,12)22-28/h27-28,35-36H,13-26H2,1-12H3 |
| InChIKey | DHFCKMBTIZEEAX-UHFFFAOYSA-N |
| XLogP | 8.37 |
| TPSA | 67.46 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 11 |
| Heavy Atoms | 44 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 658.89 |
| LogP ≤ 5 | 8.37 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'phosphor', 'substructure': 'N/A'} |
|---|