C31H62N4O4P2 — CID 21277964
N,N'-bis(5,5-dimethyl-1,3,2-dioxaphosphinan-2-yl)-N,N'-bis(2,2,6,6-tetramethylpiperidin-4-yl)propane-1,3-diamine (PubChem CID 21277964) has the molecular formula C31H62N4O4P2 and a molecular weight of 616.81 g/mol. Its IUPAC name is N,N'-bis(5,5-dimethyl-1,3,2-dioxaphosphinan-2-yl)-N,N'-bis(2,2,6,6-tetramethylpiperidin-4-yl)propane-1,3-diamine.
| Compound Name | N,N'-bis(5,5-dimethyl-1,3,2-dioxaphosphinan-2-yl)-N,N'-bis(2,2,6,6-tetramethylpiperidin-4-yl)propane-1,3-diamine |
|---|---|
| PubChem CID | 21277964 |
| Molecular Formula | C31H62N4O4P2 |
| Molecular Weight | 616.81 g/mol |
| Exact Mass | 616.42 |
| IUPAC Name | N,N'-bis(5,5-dimethyl-1,3,2-dioxaphosphinan-2-yl)-N,N'-bis(2,2,6,6-tetramethylpiperidin-4-yl)propane-1,3-diamine |
| SMILES | CC1(C)COP(N(CCCN(C2CC(C)(C)NC(C)(C)C2)P2OCC(C)(C)CO2)C2CC(C)(C)NC(C)(C)C2)OC1 |
| InChI | InChI=1S/C31H62N4O4P2/c1-26(2)20-36-40(37-21-26)34(24-16-28(5,6)32-29(7,8)17-24)14-13-15-35(41-38-22-27(3,4)23-39-41)25-18-30(9,10)33-31(11,12)19-25/h24-25,32-33H,13-23H2,1-12H3 |
| InChIKey | HXIPQNUZKDDMEV-UHFFFAOYSA-N |
| XLogP | 7.20 |
| TPSA | 67.46 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 41 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 616.81 |
| LogP ≤ 5 | 7.20 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'phosphor', 'substructure': 'N/A'} |
|---|