C30H60N4O4P2 — CID 21277968
N,N'-bis(5,5-dimethyl-1,3,2-dioxaphosphinan-2-yl)-N,N'-bis(2,2,6,6-tetramethylpiperidin-4-yl)ethane-1,2-diamine (PubChem CID 21277968) has the molecular formula C30H60N4O4P2 and a molecular weight of 602.78 g/mol. Its IUPAC name is N,N'-bis(5,5-dimethyl-1,3,2-dioxaphosphinan-2-yl)-N,N'-bis(2,2,6,6-tetramethylpiperidin-4-yl)ethane-1,2-diamine.
| Compound Name | N,N'-bis(5,5-dimethyl-1,3,2-dioxaphosphinan-2-yl)-N,N'-bis(2,2,6,6-tetramethylpiperidin-4-yl)ethane-1,2-diamine |
|---|---|
| PubChem CID | 21277968 |
| Molecular Formula | C30H60N4O4P2 |
| Molecular Weight | 602.78 g/mol |
| Exact Mass | 602.41 |
| IUPAC Name | N,N'-bis(5,5-dimethyl-1,3,2-dioxaphosphinan-2-yl)-N,N'-bis(2,2,6,6-tetramethylpiperidin-4-yl)ethane-1,2-diamine |
| SMILES | CC1(C)COP(N(CCN(C2CC(C)(C)NC(C)(C)C2)P2OCC(C)(C)CO2)C2CC(C)(C)NC(C)(C)C2)OC1 |
| InChI | InChI=1S/C30H60N4O4P2/c1-25(2)19-35-39(36-20-25)33(23-15-27(5,6)31-28(7,8)16-23)13-14-34(40-37-21-26(3,4)22-38-40)24-17-29(9,10)32-30(11,12)18-24/h23-24,31-32H,13-22H2,1-12H3 |
| InChIKey | YURWSZQZQQQANY-UHFFFAOYSA-N |
| XLogP | 6.81 |
| TPSA | 67.46 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 40 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 602.78 |
| LogP ≤ 5 | 6.81 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'phosphor', 'substructure': 'N/A'} |
|---|