C35H70N4O4P2 — CID 21277977
N,N'-bis(1,2,2,6,6-pentamethylpiperidin-4-yl)-N,N'-bis(4,4,6-trimethyl-1,3,2-dioxaphosphinan-2-yl)propane-1,3-diamine (PubChem CID 21277977) has the molecular formula C35H70N4O4P2 and a molecular weight of 672.92 g/mol. Its IUPAC name is N,N'-bis(1,2,2,6,6-pentamethylpiperidin-4-yl)-N,N'-bis(4,4,6-trimethyl-1,3,2-dioxaphosphinan-2-yl)propane-1,3-diamine.
| Compound Name | N,N'-bis(1,2,2,6,6-pentamethylpiperidin-4-yl)-N,N'-bis(4,4,6-trimethyl-1,3,2-dioxaphosphinan-2-yl)propane-1,3-diamine |
|---|---|
| PubChem CID | 21277977 |
| Molecular Formula | C35H70N4O4P2 |
| Molecular Weight | 672.92 g/mol |
| Exact Mass | 672.49 |
| IUPAC Name | N,N'-bis(1,2,2,6,6-pentamethylpiperidin-4-yl)-N,N'-bis(4,4,6-trimethyl-1,3,2-dioxaphosphinan-2-yl)propane-1,3-diamine |
| SMILES | CC1CC(C)(C)OP(N(CCCN(C2CC(C)(C)N(C)C(C)(C)C2)P2OC(C)CC(C)(C)O2)C2CC(C)(C)N(C)C(C)(C)C2)O1 |
| InChI | InChI=1S/C35H70N4O4P2/c1-26-20-34(11,12)42-44(40-26)38(28-22-30(3,4)36(15)31(5,6)23-28)18-17-19-39(45-41-27(2)21-35(13,14)43-45)29-24-32(7,8)37(16)33(9,10)25-29/h26-29H,17-25H2,1-16H3 |
| InChIKey | AGJFCFYNHUOVBA-UHFFFAOYSA-N |
| XLogP | 8.95 |
| TPSA | 49.88 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 45 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 672.92 |
| LogP ≤ 5 | 8.95 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'phosphor', 'substructure': 'N/A'} |
|---|