About 1,2-dihydropyridazine-3,6-dione;N-ethylethanamine
1,2-dihydropyridazine-3,6-dione;N-ethylethanamine (PubChem CID 21278031) has the molecular formula C8H15N3O2
and a molecular weight of 185.23 g/mol. Its IUPAC name is 1,2-dihydropyridazine-3,6-dione;N-ethylethanamine.
Molecular Properties
| Compound Name | 1,2-dihydropyridazine-3,6-dione;N-ethylethanamine |
| PubChem CID | 21278031 |
| Molecular Formula | C8H15N3O2 |
| Molecular Weight | 185.23 g/mol |
| Exact Mass | 185.12 |
| IUPAC Name | 1,2-dihydropyridazine-3,6-dione;N-ethylethanamine |
| SMILES | CCNCC.O=c1ccc(=O)[nH][nH]1 |
| InChI | InChI=1S/C4H4N2O2.C4H11N/c7-3-1-2-4(8)6-5-3;1-3-5-4-2/h1-2H,(H,5,7)(H,6,8);5H,3-4H2,1-2H3 |
| InChIKey | KAZGUEXLRUBBOH-UHFFFAOYSA-N |
| XLogP | -0.32 |
| TPSA | 77.75 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 13 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 185.23 |
| LogP ≤ 5 | -0.32 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 3 |
Analyze 1,2-dihydropyridazine-3,6-dione;N-ethylethanamine with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 1,2-dihydropyridazine-3,6-dione;N-ethylethanamine?
The IUPAC name of 1,2-dihydropyridazine-3,6-dione;N-ethylethanamine (CID 21278031) is 1,2-dihydropyridazine-3,6-dione;N-ethylethanamine.
What is the SMILES notation for 1,2-dihydropyridazine-3,6-dione;N-ethylethanamine?
The canonical SMILES for 1,2-dihydropyridazine-3,6-dione;N-ethylethanamine is CCNCC.O=c1ccc(=O)[nH][nH]1.
What is the InChIKey of 1,2-dihydropyridazine-3,6-dione;N-ethylethanamine?
The InChIKey is KAZGUEXLRUBBOH-UHFFFAOYSA-N. The full InChI is InChI=1S/C4H4N2O2.C4H11N/c7-3-1-2-4(8)6-5-3;1-3-5-4-2/h1-2H,(H,5,7)(H,6,8);5H,3-4H2,1-2H3.
What are the key properties of 1,2-dihydropyridazine-3,6-dione;N-ethylethanamine?
1,2-dihydropyridazine-3,6-dione;N-ethylethanamine has a molecular weight of 185.23 g/mol, XLogP of -0.32, 2 rotatable bonds, 3 hydrogen bond donors, and 3 hydrogen bond acceptors.
Where does this data come from?
All data for 1,2-dihydropyridazine-3,6-dione;N-ethylethanamine is sourced from PubChem (CID 21278031), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).