About hexan-3-ylphosphane
hexan-3-ylphosphane (PubChem CID 21278560) has the molecular formula C6H15P
and a molecular weight of 118.16 g/mol. Its IUPAC name is hexan-3-ylphosphane.
Molecular Properties
| Compound Name | hexan-3-ylphosphane |
| PubChem CID | 21278560 |
| Molecular Formula | C6H15P |
| Molecular Weight | 118.16 g/mol |
| Exact Mass | 118.09 |
| IUPAC Name | hexan-3-ylphosphane |
| SMILES | CCCC(P)CC |
| InChI | InChI=1S/C6H15P/c1-3-5-6(7)4-2/h6H,3-5,7H2,1-2H3 |
| InChIKey | ZPZZKNJQGCUFFP-UHFFFAOYSA-N |
| XLogP | 2.44 |
| TPSA | 0.00 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | |
| Rotatable Bonds | 3 |
| Heavy Atoms | 7 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 118.16 |
| LogP ≤ 5 | 2.44 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 0 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'phosphor', 'substructure': 'N/A'} |
|---|
Analyze hexan-3-ylphosphane with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of hexan-3-ylphosphane?
The IUPAC name of hexan-3-ylphosphane (CID 21278560) is hexan-3-ylphosphane.
What is the SMILES notation for hexan-3-ylphosphane?
The canonical SMILES for hexan-3-ylphosphane is CCCC(P)CC.
What is the InChIKey of hexan-3-ylphosphane?
The InChIKey is ZPZZKNJQGCUFFP-UHFFFAOYSA-N. The full InChI is InChI=1S/C6H15P/c1-3-5-6(7)4-2/h6H,3-5,7H2,1-2H3.
What are the key properties of hexan-3-ylphosphane?
hexan-3-ylphosphane has a molecular weight of 118.16 g/mol, XLogP of 2.44, 3 rotatable bonds, 0 hydrogen bond donors, and 0 hydrogen bond acceptors.
Where does this data come from?
All data for hexan-3-ylphosphane is sourced from PubChem (CID 21278560), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).