C16H22N6O6 — CID 21278587
2-[3-(2-hydroxyethylamino)-2-nitroanilino]ethanol;2-nitrobenzene-1,3-diamine (PubChem CID 21278587) has the molecular formula C16H22N6O6 and a molecular weight of 394.39 g/mol. Its IUPAC name is 2-[3-(2-hydroxyethylamino)-2-nitroanilino]ethanol;2-nitrobenzene-1,3-diamine.
| Compound Name | 2-[3-(2-hydroxyethylamino)-2-nitroanilino]ethanol;2-nitrobenzene-1,3-diamine |
|---|---|
| PubChem CID | 21278587 |
| Molecular Formula | C16H22N6O6 |
| Molecular Weight | 394.39 g/mol |
| Exact Mass | 394.16 |
| IUPAC Name | 2-[3-(2-hydroxyethylamino)-2-nitroanilino]ethanol;2-nitrobenzene-1,3-diamine |
| SMILES | Nc1cccc(N)c1[N+](=O)[O-].O=[N+]([O-])c1c(NCCO)cccc1NCCO |
| InChI | InChI=1S/C10H15N3O4.C6H7N3O2/c14-6-4-11-8-2-1-3-9(12-5-7-15)10(8)13(16)17;7-4-2-1-3-5(8)6(4)9(10)11/h1-3,11-12,14-15H,4-7H2;1-3H,7-8H2 |
| InChIKey | UDPUESRARARZMA-UHFFFAOYSA-N |
| XLogP | 1.16 |
| TPSA | 202.84 Ų |
| H-Bond Donors | 6 |
| H-Bond Acceptors | 10 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 28 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 394.39 |
| LogP ≤ 5 | 1.16 |
| H-Bond Donors ≤ 5 | 6 |
| H-Bond Acceptors ≤ 10 | 10 |
| Structural Alerts | {'alert_name': 'aniline', 'substructure': 'N/A'}, {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|